@charset "UTF-8";

/* module.scss */
html {
  font-size: 62.5%;
  overflow: auto;
  color: rgb(0, 0, 26);
  font-family: "Noto sans JP", "Yu Mincho", "YuMincho", "Hiragino Mincho ProN", "Noto Serif", sans-serif;
}

.bold {
  font-weight: bold;
}

.under-line {
  text-decoration: underline;
}

img {
  vertical-align: bottom;
}

body {
  overflow-x: hidden;
  width: 100%;
  min-width: 1260px;
  font-size: 1.4rem;
  color: #2D2E31;
   font-family: "Noto sans JP", "Yu Mincho", "YuMincho", "Hiragino Mincho ProN", "Noto Serif", sans-serif;
  line-height: 1.7;
  letter-spacing: 0.05em;
  letter-spacing: 0.12em;
}

@media screen and (max-width: 767px) {
  body {
    min-width: 320px;
  }
}

p {
  font-weight: 300;
}

sup {
  font-size: 0.8em;
  position: relative;
  left: 0px;
  bottom: 0.2em;
}

sub {
  font-size: 0.8em;
  position: relative;
  left: 0px;
  top: 0.2em;
}

ul,
li {
  list-style-type: none;
}

.nobr,
nobr {
  display: inline-block;
  white-space: nowrap;
}

span,
a {
  display: inline-block;
}

label {
  cursor: pointer;
}

button {
  margin: 10px 0px;
  background: transparent;
  -webkit-border-image: none;
  outline: none;
  -webkit-box-shadow: none;
  box-shadow: none;
  border: none;
  -webkit-appearance: none;
  -moz-appearance: none;
  appearance: none;
  -webkit-rtl-ordering: logical;
  cursor: pointer;
}

.is-hide {
  display: none !important;
}

.lts-n {
  letter-spacing: -0.04em;
}

.lts-ss {
  letter-spacing: -0.08em;
}

span[class*=lts-] {
  display: inline;
}

.f-half {
  width: 0.4em;
}

.fz-ss {
  font-size: 0.6em !important;
}

.fz-s {
  font-size: 0.85em !important;
}

.fz-l {
  font-size: 1.2em !important;
}

.fz-ll {
  font-size: 1.4em !important;
}

.fz-lll {
  font-size: 1.6em !important;
}

.ta-c {
  text-align: center !important;
}

.ta-r {
  text-align: right !important;
}

.ta-l {
  text-align: left !important;
}

.ta-j {
  -webkit-font-feature-settings: "palt";
  font-feature-settings: "palt";
  text-align: justify !important;
}

span.ta-c {
  display: inline-block;
  text-align: center !important;
}

span.ta-r {
  display: inline-block;
  text-align: right !important;
}

span.ta-l {
  display: inline-block;
  text-align: left !important;
}

@media only screen and (max-width: 767px) {
  .sp-ta-c {
    text-align: center !important;
  }

  .sp-ta-r {
    text-align: right !important;
  }

  .sp-ta-l {
    text-align: left !important;
  }
}

.va-m,
.va-t,
.va-b {
  display: table-cell !important;
}

.va-m {
  vertical-align: middle !important;
}

.va-t {
  vertical-align: top !important;
}

.va-b {
  vertical-align: bottom !important;
}

.mw-auto {
  margin-left: auto !important;
  margin-right: auto !important;
}

.mt-0,
.mh-0,
.ma-0 {
  margin-top: 0rem !important;
}

.mr-0,
.mw-0,
.ma-0 {
  margin-right: 0rem !important;
}

.mb-0,
.mh-0,
.ma-0 {
  margin-bottom: 0rem !important;
}

.ml-0,
.mw-0,
.ma-0 {
  margin-left: 0rem !important;
}

.pt-0,
.ph-0,
.pa-0 {
  padding-top: 0rem !important;
}

.pr-0,
.pw-0,
.pa-0 {
  padding-right: 0rem !important;
}

.pb-0,
.ph-0,
.pa-0 {
  padding-bottom: 0rem !important;
}

.pl-0,
.pw-0,
.pa-0 {
  padding-left: 0rem !important;
}

.mt-5,
.mh-5,
.ma-5 {
  margin-top: 0.5rem !important;
}

.mr-5,
.mw-5,
.ma-5 {
  margin-right: 0.5rem !important;
}

.mb-5,
.mh-5,
.ma-5 {
  margin-bottom: 0.5rem !important;
}

.ml-5,
.mw-5,
.ma-5 {
  margin-left: 0.5rem !important;
}

.pt-5,
.ph-5,
.pa-5 {
  padding-top: 0.5rem !important;
}

.pr-5,
.pw-5,
.pa-5 {
  padding-right: 0.5rem !important;
}

.pb-5,
.ph-5,
.pa-5 {
  padding-bottom: 0.5rem !important;
}

.pl-5,
.pw-5,
.pa-5 {
  padding-left: 0.5rem !important;
}

.mt-10,
.mh-10,
.ma-10 {
  margin-top: 1rem !important;
}

.mr-10,
.mw-10,
.ma-10 {
  margin-right: 1rem !important;
}

.mb-10,
.mh-10,
.ma-10 {
  margin-bottom: 1rem !important;
}

.ml-10,
.mw-10,
.ma-10 {
  margin-left: 1rem !important;
}

.pt-10,
.ph-10,
.pa-10 {
  padding-top: 1rem !important;
}

.pr-10,
.pw-10,
.pa-10 {
  padding-right: 1rem !important;
}

.pb-10,
.ph-10,
.pa-10 {
  padding-bottom: 1rem !important;
}

.pl-10,
.pw-10,
.pa-10 {
  padding-left: 1rem !important;
}

.mt-15,
.mh-15,
.ma-15 {
  margin-top: 1.5rem !important;
}

.mr-15,
.mw-15,
.ma-15 {
  margin-right: 1.5rem !important;
}

.mb-15,
.mh-15,
.ma-15 {
  margin-bottom: 1.5rem !important;
}

.ml-15,
.mw-15,
.ma-15 {
  margin-left: 1.5rem !important;
}

.pt-15,
.ph-15,
.pa-15 {
  padding-top: 1.5rem !important;
}

.pr-15,
.pw-15,
.pa-15 {
  padding-right: 1.5rem !important;
}

.pb-15,
.ph-15,
.pa-15 {
  padding-bottom: 1.5rem !important;
}

.pl-15,
.pw-15,
.pa-15 {
  padding-left: 1.5rem !important;
}

.mt-20,
.mh-20,
.ma-20 {
  margin-top: 2rem !important;
}

.mr-20,
.mw-20,
.ma-20 {
  margin-right: 2rem !important;
}

.mb-20,
.mh-20,
.ma-20 {
  margin-bottom: 2rem !important;
}

.ml-20,
.mw-20,
.ma-20 {
  margin-left: 2rem !important;
}

.pt-20,
.ph-20,
.pa-20 {
  padding-top: 2rem !important;
}

.pr-20,
.pw-20,
.pa-20 {
  padding-right: 2rem !important;
}

.pb-20,
.ph-20,
.pa-20 {
  padding-bottom: 2rem !important;
}

.pl-20,
.pw-20,
.pa-20 {
  padding-left: 2rem !important;
}

.mt-25,
.mh-25,
.ma-25 {
  margin-top: 2.5rem !important;
}

.mr-25,
.mw-25,
.ma-25 {
  margin-right: 2.5rem !important;
}

.mb-25,
.mh-25,
.ma-25 {
  margin-bottom: 2.5rem !important;
}

.ml-25,
.mw-25,
.ma-25 {
  margin-left: 2.5rem !important;
}

.pt-25,
.ph-25,
.pa-25 {
  padding-top: 2.5rem !important;
}

.pr-25,
.pw-25,
.pa-25 {
  padding-right: 2.5rem !important;
}

.pb-25,
.ph-25,
.pa-25 {
  padding-bottom: 2.5rem !important;
}

.pl-25,
.pw-25,
.pa-25 {
  padding-left: 2.5rem !important;
}

.mt-30,
.mh-30,
.ma-30 {
  margin-top: 3rem !important;
}

.mr-30,
.mw-30,
.ma-30 {
  margin-right: 3rem !important;
}

.mb-30,
.mh-30,
.ma-30 {
  margin-bottom: 3rem !important;
}

.ml-30,
.mw-30,
.ma-30 {
  margin-left: 3rem !important;
}

.pt-30,
.ph-30,
.pa-30 {
  padding-top: 3rem !important;
}

.pr-30,
.pw-30,
.pa-30 {
  padding-right: 3rem !important;
}

.pb-30,
.ph-30,
.pa-30 {
  padding-bottom: 3rem !important;
}

.pl-30,
.pw-30,
.pa-30 {
  padding-left: 3rem !important;
}

.mt-35,
.mh-35,
.ma-35 {
  margin-top: 3.5rem !important;
}

.mr-35,
.mw-35,
.ma-35 {
  margin-right: 3.5rem !important;
}

.mb-35,
.mh-35,
.ma-35 {
  margin-bottom: 3.5rem !important;
}

.ml-35,
.mw-35,
.ma-35 {
  margin-left: 3.5rem !important;
}

.pt-35,
.ph-35,
.pa-35 {
  padding-top: 3.5rem !important;
}

.pr-35,
.pw-35,
.pa-35 {
  padding-right: 3.5rem !important;
}

.pb-35,
.ph-35,
.pa-35 {
  padding-bottom: 3.5rem !important;
}

.pl-35,
.pw-35,
.pa-35 {
  padding-left: 3.5rem !important;
}

.mt-40,
.mh-40,
.ma-40 {
  margin-top: 4rem !important;
}

.mr-40,
.mw-40,
.ma-40 {
  margin-right: 4rem !important;
}

.mb-40,
.mh-40,
.ma-40 {
  margin-bottom: 4rem !important;
}

.ml-40,
.mw-40,
.ma-40 {
  margin-left: 4rem !important;
}

.pt-40,
.ph-40,
.pa-40 {
  padding-top: 4rem !important;
}

.pr-40,
.pw-40,
.pa-40 {
  padding-right: 4rem !important;
}

.pb-40,
.ph-40,
.pa-40 {
  padding-bottom: 4rem !important;
}

.pl-40,
.pw-40,
.pa-40 {
  padding-left: 4rem !important;
}

.mt-45,
.mh-45,
.ma-45 {
  margin-top: 4.5rem !important;
}

.mr-45,
.mw-45,
.ma-45 {
  margin-right: 4.5rem !important;
}

.mb-45,
.mh-45,
.ma-45 {
  margin-bottom: 4.5rem !important;
}

.ml-45,
.mw-45,
.ma-45 {
  margin-left: 4.5rem !important;
}

.pt-45,
.ph-45,
.pa-45 {
  padding-top: 4.5rem !important;
}

.pr-45,
.pw-45,
.pa-45 {
  padding-right: 4.5rem !important;
}

.pb-45,
.ph-45,
.pa-45 {
  padding-bottom: 4.5rem !important;
}

.pl-45,
.pw-45,
.pa-45 {
  padding-left: 4.5rem !important;
}

.mt-50,
.mh-50,
.ma-50 {
  margin-top: 5rem !important;
}

.mr-50,
.mw-50,
.ma-50 {
  margin-right: 5rem !important;
}

.mb-50,
.mh-50,
.ma-50 {
  margin-bottom: 5rem !important;
}

.ml-50,
.mw-50,
.ma-50 {
  margin-left: 5rem !important;
}

.pt-50,
.ph-50,
.pa-50 {
  padding-top: 5rem !important;
}

.pr-50,
.pw-50,
.pa-50 {
  padding-right: 5rem !important;
}

.pb-50,
.ph-50,
.pa-50 {
  padding-bottom: 5rem !important;
}

.pl-50,
.pw-50,
.pa-50 {
  padding-left: 5rem !important;
}

.w-0 {
  width: 0% !important;
}

.w-5 {
  width: 5% !important;
}

.w-10 {
  width: 10% !important;
}

.w-15 {
  width: 15% !important;
}

.w-20 {
  width: 20% !important;
}

.w-25 {
  width: 25% !important;
}

.w-30 {
  width: 30% !important;
}

.w-35 {
  width: 35% !important;
}

.w-40 {
  width: 40% !important;
}

.w-45 {
  width: 45% !important;
}

.w-50 {
  width: 50% !important;
}

.w-55 {
  width: 55% !important;
}

.w-60 {
  width: 60% !important;
}

.w-65 {
  width: 65% !important;
}

.w-70 {
  width: 70% !important;
}

.w-75 {
  width: 75% !important;
}

.w-80 {
  width: 80% !important;
}

.w-85 {
  width: 85% !important;
}

.w-90 {
  width: 90% !important;
}

.w-95 {
  width: 95% !important;
}

.w-100 {
  width: 100% !important;
}

.px-100 {
  width: 100px !important;
}

.px-105 {
  width: 105px !important;
}

.px-110 {
  width: 110px !important;
}

.px-115 {
  width: 115px !important;
}

.px-120 {
  width: 120px !important;
}

.px-125 {
  width: 125px !important;
}

.px-130 {
  width: 130px !important;
}

.px-135 {
  width: 135px !important;
}

.px-140 {
  width: 140px !important;
}

.px-145 {
  width: 145px !important;
}

.px-150 {
  width: 150px !important;
}

.px-155 {
  width: 155px !important;
}

.px-160 {
  width: 160px !important;
}

.px-165 {
  width: 165px !important;
}

.px-170 {
  width: 170px !important;
}

.px-175 {
  width: 175px !important;
}

.px-180 {
  width: 180px !important;
}

.px-185 {
  width: 185px !important;
}

.px-190 {
  width: 190px !important;
}

.px-195 {
  width: 195px !important;
}

.px-200 {
  width: 200px !important;
}

.px-205 {
  width: 205px !important;
}

.px-210 {
  width: 210px !important;
}

.px-215 {
  width: 215px !important;
}

.px-220 {
  width: 220px !important;
}

.px-225 {
  width: 225px !important;
}

.mt-60 {
  margin-top: 60px !important;
}

.pt-60 {
  padding-top: 60px !important;
}

.row {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  list-style-type: none;
}

@media screen and (max-width: 767px) {
  .row {
    -webkit-box-orient: vertical;
    -webkit-box-direction: normal;
    -ms-flex-direction: column;
    flex-direction: column;
  }
}

.row__col {
  width: 100%;
  margin-bottom: 30px;
}

.row__col:nth-of-type(3n) {
  margin-right: 0;
}

@media screen and (max-width: 767px) {
  .row__col {
    margin: 0 auto 8vw auto;
  }
}

.row__col> :last-child {
  margin-bottom: 0px;
}

.row--col2:last-child {
  margin-bottom: 120px;
}

.row--col2 .row__col {
  width: calc(50% - 15px);
  margin-right: 30px;
}

@media screen and (max-width: 767px) {
  .row--col2 .row__col {
    width: 100%;
    margin-right: 0;
  }
}

.row--col2 .row__col:nth-of-type(2n) {
  margin-right: 0;
}

.row--col3 {
  margin-bottom: 120px;
}

.row--col3 .row__col {
  width: calc(33.3% - 20px);
  margin-right: 30px;
}

@media screen and (max-width: 767px) {
  .row--col3 .row__col {
    width: calc(50% - 15px);
    margin-right: 0;
  }
}

.row--col3 .row__col:nth-of-type(3n) {
  margin-right: 0;
}

@media screen and (max-width: 767px) {
  .row--col3 .row__col:nth-of-type(2n-1) {
    margin-right: 30px !important;
  }
}

@media screen and (max-width: 767px) {
  .row--col3 {
    -webkit-box-orient: horizontal;
    -webkit-box-direction: normal;
    -ms-flex-direction: row;
    flex-direction: row;
  }
}

.section__inner> :first-child {
  margin-top: 0px;
}

.section__inner> :last-child {
  margin-bottom: 0px;
}

.section+.section {
  margin-top: 80px;
}

.section:last-child {
  margin-bottom: 50px;
}

.content--top .section {
  padding: 40px 0px;
}

.list {
  line-height: 2;
  font-weight: 300;
  color: #2d2e31 !important;
  margin-bottom: 60px;
}

.list li a {
  text-indent: initial;
}

.list li span {
  display: inline;
}

.list>li {
  list-style-type: none;
  text-indent: -1.5em;
  margin-left: 1.5em !important;
  margin-bottom: 20px;
}

.list>li::before {
  content: "";
  display: inline-block;
  width: 0.2em;
  height: 0.2em;
  vertical-align: middle;
  background-color: #a6aab4;
  border-radius: 50%;
  text-indent: 0px;
  margin-left: 0.5em;
  margin-right: 0.5em;
}

.listNote {
  line-height: 2;
}

.listNote>li {
  padding-left: 1.5em;
}

.listNote>li::before {
  content: "??";
  width: 1.5em;
  display: inline-block;
  position: relative;
  margin-left: -1.5em;
}

.listNoteNum {
  font-size: 1.2rem;
}

.listNoteNum>li {
  list-style-type: none;
  text-indent: -2em;
  margin-left: 2em;
  counter-increment: calc-ex9 1;
}

.listNoteNum>li::before {
  content: "??" counter(calc-ex9);
  display: inline-block;
  width: 2em;
  text-indent: 0px;
}

.bnrs {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  -webkit-box-pack: justify;
  -ms-flex-pack: justify;
  justify-content: space-between;
}

.pagenation {
  margin: 30px 0px;
  padding: 0px;
  text-align: center;
}

.pagenation a {
  color: white;
}

.pagenation__btn a:hover {
  background-color: rgb(204, 204, 204);
  color: rgb(255, 255, 255);
}

.pagenation__list {
  letter-spacing: -0.5em;
}

.pagenation__link {
  position: relative;
  letter-spacing: 0.04em;
  display: inline-block;
  margin: 0px 4px;
  color: rgb(51, 51, 51);
}

.pagenation__btn {
  letter-spacing: 0.04em;
  display: inline-block;
  margin: 0px 7px;
}

@media screen and (max-width: 767px) {
  .pagenation__btn {
    margin: 0px 0.8vw;
  }
}

.pagenation__btn a {
  display: inline-block;
  height: 50px;
  line-height: 50px;
  min-width: 50px;
  text-align: center;
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
  font-size: 2rem;
  -webkit-transition: all 0.3s ease 0s;
  transition: all 0.3s ease 0s;
  background-color: #ffffff;
  border-radius: 5px;
  border: 1px solid #7481d1;
  color: #7481d1;
}

@media screen and (max-width: 767px) {
  .pagenation__btn a {
    min-width: 8vw;
    height: 8vw;
    line-height: 8vw;
    font-size: 2.6666666667vw;
  }
}

.pagenation .cur a {
  color: #ffffff;
  background-color: #7481d1;
}

.pagenation__link {
  margin: 0px 5px;
}

.pagenation__link a {
  -webkit-transition: all 0.3s ease 0s;
  transition: all 0.3s ease 0s;
  padding: 10px 0px;
}

.pagenation__link a:hover {
  opacity: 0.75;
}

.pagenation__link--first a {
  position: relative;
}

.pagenation__link--first a::before {
  content: "";
  display: block;
  position: absolute;
  top: 50%;
  left: 10px;
  width: 15px;
  height: 15px;
  border-top: 1px solid #7481d1;
  border-right: 1px solid #7481d1;
  border-bottom-color: rgb(233, 233, 233);
  border-left-color: rgb(233, 233, 233);
  -webkit-transform-origin: center center;
  transform-origin: center center;
  -webkit-transform: translateX(-50%) translateY(-50%) rotate(-135deg);
  transform: translateX(-50%) translateY(-50%) rotate(-135deg);
}

@media screen and (max-width: 767px) {
  .pagenation__link--first a::before {
    width: 10px;
    height: 10px;
    left: 7px;
  }
}

.pagenation__link--last a {
  position: relative;
}

.pagenation__link--last a::before {
  content: "";
  display: block;
  position: absolute;
  top: 50%;
  right: 10px;
  width: 15px;
  height: 15px;
  border-top: 1px solid #7481d1;
  border-right: 1px solid #7481d1;
  border-bottom-color: rgb(233, 233, 233);
  border-left-color: rgb(233, 233, 233);
  -webkit-transform-origin: center center;
  transform-origin: center center;
  -webkit-transform: translateX(50%) translateY(-50%) rotate(45deg);
  transform: translateX(50%) translateY(-50%) rotate(45deg);
}

@media screen and (max-width: 767px) {
  .pagenation__link--last a::before {
    width: 10px;
    height: 10px;
    right: 7px;
  }
}

.pagenation__link--prev {
  padding: 0px;
}

.pagenation__link--prev a {
  color: transparent;
  position: relative;
  padding: 0.3rem 1rem;
}

@media screen and (max-width: 767px) {
  .pagenation__link--prev a {
    padding: 0;
  }
}

.pagenation__link--prev a::before {
  content: "";
  display: block;
  position: absolute;
  top: 50%;
  width: 15px;
  height: 15px;
  border-top: 1px solid #7481d1;
  border-right: 1px solid #7481d1;
  border-bottom-color: rgb(233, 233, 233);
  border-left-color: rgb(233, 233, 233);
  border-bottom-color: rgb(233, 233, 233);
  border-left-color: rgb(233, 233, 233);
  -webkit-transform-origin: center center;
  transform-origin: center center;
  -webkit-transform: translateX(-50%) translateY(-50%) rotate(-135deg);
  transform: translateX(-50%) translateY(-50%) rotate(-135deg);
}

@media screen and (max-width: 767px) {
  .pagenation__link--prev a::before {
    height: 10px;
    width: 10px;
  }
}

.pagenation__link--first a::after {
  content: "";
  display: block;
  position: absolute;
  top: 50%;
  left: -1px;
  width: 1px;
  height: 21px;
  background-color: #7481d1;
  -webkit-transform: translateX(50%) translateY(-50%);
  transform: translateX(50%) translateY(-50%);
}

@media screen and (max-width: 767px) {
  .pagenation__link--first a::after {
    height: 14px;
  }
}

.pagenation__link--next {
  padding: 0px;
}

.pagenation__link--next a {
  color: transparent;
  position: relative;
  padding: 0.3rem 1rem;
}

@media screen and (max-width: 767px) {
  .pagenation__link--next a {
    padding: 0;
  }
}

.pagenation__link--next a::before {
  content: "";
  display: block;
  position: absolute;
  top: 50%;
  left: 0.5em;
  width: 15px;
  height: 15px;
  border-top: 1px solid #7481d1;
  border-right: 1px solid #7481d1;
  border-bottom-color: rgb(233, 233, 233);
  border-left-color: rgb(233, 233, 233);
  border-bottom-color: rgb(233, 233, 233);
  border-left-color: rgb(233, 233, 233);
  -webkit-transform-origin: center center;
  transform-origin: center center;
  -webkit-transform: translateX(50%) translateY(-50%) rotate(45deg);
  transform: translateX(50%) translateY(-50%) rotate(45deg);
}

@media screen and (max-width: 767px) {
  .pagenation__link--next a::before {
    width: 10px;
    height: 10px;
  }
}

.pagenation__link--last a::after {
  content: "";
  display: block;
  position: absolute;
  top: 50%;
  right: 0px;
  width: 1px;
  height: 21px;
  background-color: #7481d1;
  -webkit-transform: translateX(50%) translateY(-50%);
  transform: translateX(50%) translateY(-50%);
}

@media screen and (max-width: 767px) {
  .pagenation__link--last a::after {
    height: 14px;
  }
}

.figure {
  overflow: hidden;
}

.lytImage {
  margin: 50px 0px;
}

.lytImage::after {
  content: "";
  display: block;
  clear: both;
}

.lytImage__text span {
  display: inline;
}

.lytImage--imageLeft .lytImage__figure {
  float: left;
  padding-right: 30px;
}

.lytImage--imageRight .lytImage__figure {
  float: right;
  padding-left: 30px;
}

.lytImage .lytImage__figure {
  max-width: 50%;
  margin: 0px;
}

.lytImage .lytImage__figure img {
  margin-bottom: 10px;
}

.lytImage .lytImage__figure figcaption p {
  margin: 0px;
}

figcaption p {
  font-size: 1.2rem;
}

.dl01 dt {
  padding: 10px 20px;
  text-align: center;
  border: 1px solid rgb(0, 0, 26);
  display: inline-block;
  min-width: 280px;
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
  margin-bottom: 15px;
}

.icon {
  font-weight: bold;
  font-size: 1.4rem;
  padding: 0px 3px;
  line-height: 1;
  margin: 0px 15px;
}

.icon--inquired {
  background: rgb(247, 128, 126);
  border-radius: 3px;
  color: white;
  font-size: 1.2rem;
  padding: 3px 10px 2px;
}

.textNote {
  font-size: 0.8em;
}

.tableForm {
  width: 100%;
  margin: 40px 0px;
  border-collapse: separate;
  border-spacing: 1px;
  background: rgb(204, 204, 204);
  color: rgb(85, 85, 85);
  font-size: 1.4rem;
}

.tableForm tr th,
.tableForm tr td {
  background: white;
  padding: 9px 15px;
  font-weight: normal;
  text-align: left;
}

.tableForm tr th {
  background: rgb(246, 246, 246);
  font-weight: bold;
  padding: 20px 15px;
  vertical-align: middle;
}

.tableForm tr td {
  vertical-align: middle;
}

.tableForm input {
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
  width: 300px !important;
}

.tableForm input+[class*=textNote],
.tableForm label+[class*=textNote],
.tableForm select+[class*=textNote] {
  display: inline-block;
  margin: 0px 0px 0px 10px;
}

.innerList {
  margin: 20px 0px;
  display: table;
  width: 100%;
}

.innerList>dt {
  display: table-cell;
  text-align: left;
  vertical-align: middle;
}

.innerList>dt:nth-of-type(1) {
  width: 20%;
}

.innerList>dt,
.innerList>dd {
  display: table-cell;
  text-align: left;
  vertical-align: middle;
}

input[type=radio].radio {
  display: none;
}

input[type=radio].radio+label {
  padding-left: 20px;
  position: relative;
  margin-right: 20px;
}

input[type=radio].radio+label::before {
  content: "";
  display: block;
  position: absolute;
  top: 2px;
  left: 0px;
  width: 14px;
  height: 14px;
  border: 1px solid rgb(153, 153, 153);
  border-radius: 50%;
}

input[type=radio].radio:checked+label::after {
  content: "";
  display: block;
  position: absolute;
  top: 5px;
  left: 3px;
  width: 10px;
  height: 10px;
  background: rgb(182, 182, 182);
  border-radius: 50%;
}

input[type=radio].radio__text {
  font-size: 1.4rem;
}

button.btnSubmit {
  border-radius: 0px;
  border: none;
  display: table;
  margin: 20px auto;
  background: rgb(0, 47, 95);
  height: 60px;
  color: white;
  font-size: 1.6rem;
  -webkit-transition: background 0.3s ease 0s;
  transition: background 0.3s ease 0s;
  letter-spacing: 0.05em;
}

button.btnSubmit>span {
  min-width: 330px;
  display: table-cell;
  vertical-align: middle;
  text-align: center;
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
}

button.btnSubmit:not([disabled]):hover {
  background: rgba(0, 47, 95, 0.5);
}

.btnSubmit:not(button) {
  cursor: pointer;
  border-radius: 0px;
  border: none;
  display: table;
  margin: 20px auto;
  background: rgb(0, 159, 157);
  height: 60px;
  color: white;
  font-size: 1.6rem;
  -webkit-transition: background 0.3s ease 0s;
  transition: background 0.3s ease 0s;
  letter-spacing: 0.05em;
  position: relative;
  overflow: hidden;
}

.btnSubmit:not(button) input[type=submit] {
  opacity: 0;
  position: absolute;
  top: 0px;
  left: 0px;
  width: 100%;
  height: 100%;
  z-index: 1;
  margin: 0px;
  padding: 0px;
}

.btnSubmit:not(button)>span {
  min-width: 330px;
  display: table-cell;
  vertical-align: middle;
  text-align: center;
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
  position: relative;
  z-index: 0;
}

.btnSubmit:not(button)::before {
  content: "";
  display: block;
  width: 100%;
  height: 100%;
  min-height: 60px;
  z-index: 0;
  background: rgb(30, 60, 145);
  -webkit-transform-origin: left top;
  transform-origin: left top;
  -webkit-transform: scale(0, 1);
  transform: scale(0, 1);
  -webkit-transition: all 0.3s ease 0s;
  transition: all 0.3s ease 0s;
  position: absolute;
  left: 0px;
  top: 0px;
}

.btnSubmit:not(button):not(.is-disabled):hover::before {
  -webkit-transform-origin: left top;
  transform-origin: left top;
  -webkit-transform: scale(1, 1);
  transform: scale(1, 1);
}

.btn {
  min-width: 280px;
  text-align: center;
  height: 50px;
  display: table;
  margin: auto;
  font-weight: bold;
  font-size: 1.8rem;
  -webkit-transition: all 0.3s ease 0s;
  transition: all 0.3s ease 0s;
}

.btn>span {
  display: table-cell;
  vertical-align: middle;
}

.btn:hover {
  text-decoration: none;
  opacity: 0.75;
}

.btn--01 {
  background: rgb(255, 240, 0);
  color: rgb(30, 60, 145);
}

.btn--01>span>span {
  position: relative;
  padding: 0px 1.8em;
}

.btn--01>span>span::after {
  content: "";
  display: block;
  position: absolute;
  top: 50%;
  right: 0.5em;
  width: 8px;
  height: 8px;
  border-top: 2px solid rgb(30, 60, 145);
  border-right: 2px solid rgb(30, 60, 145);
  border-bottom-color: rgb(30, 60, 145);
  border-left-color: rgb(30, 60, 145);
  -webkit-transform-origin: center center;
  transform-origin: center center;
  -webkit-transform: translateY(-50%) rotate(45deg);
  transform: translateY(-50%) rotate(45deg);
}

.btn--01 .icon--window {
  margin-left: 0.2em;
  margin-top: -0.4em;
  vertical-align: middle;
  display: inline-block;
}

.btn--02 {
  background: rgb(30, 60, 145);
  color: white;
}

.btn--02>span>span {
  position: relative;
  padding: 0px 1.8em;
}

.btn--02>span>span::after {
  content: "";
  display: block;
  position: absolute;
  top: 50%;
  right: 0.5em;
  width: 8px;
  height: 8px;
  border-top: 2px solid white;
  border-right: 2px solid white;
  border-bottom-color: white;
  border-left-color: white;
  -webkit-transform-origin: center center;
  transform-origin: center center;
  -webkit-transform: translateY(-50%) rotate(45deg);
  transform: translateY(-50%) rotate(45deg);
}

.btn--02 .icon--window {
  margin-left: 0.2em;
  margin-top: -0.4em;
  vertical-align: middle;
  display: inline-block;
}

.btn--380 {
  width: 380px;
}

.btn--back {
  background: rgb(255, 240, 0);
  color: rgb(30, 60, 145);
}

.btn--back>span>span {
  position: relative;
  padding: 0px 1.8em;
}

.btn--back>span>span::after {
  content: "";
  display: block;
  position: absolute;
  top: 50%;
  left: 0.5em;
  width: 8px;
  height: 8px;
  border-top: 2px solid rgb(30, 60, 145);
  border-right: 2px solid rgb(30, 60, 145);
  border-bottom-color: rgb(30, 60, 145);
  border-left-color: rgb(30, 60, 145);
  -webkit-transform-origin: center center;
  transform-origin: center center;
  -webkit-transform: translateY(-50%) rotate(-135deg);
  transform: translateY(-50%) rotate(-135deg);
}

.btn--request {
  background: rgb(30, 60, 145);
  max-width: 800px;
  width: 100%;
  color: white;
}

.label--01 {
  background: rgb(30, 60, 145);
  color: white;
  font-size: 1.2rem;
  min-width: 117px;
  text-align: center;
  height: 22px;
  line-height: 22px;
}

.label--02 {
  background: rgb(30, 60, 145);
  color: white;
  font-size: 1.2rem;
  min-width: 156px;
  text-align: center;
  height: 27px;
  line-height: 27px;
}

.btns {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
  -ms-flex-pack: center;
  justify-content: center;
}

.btns .btn {
  margin: 0px 50px;
}

.important {
  width: 1200px;
  margin: 60px auto;
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
  border: 3px solid rgb(172, 39, 65);
  padding: 27px;
}

.important__title {
  font-size: 2.8rem;
  margin-bottom: 25px;
  text-align: center;
  border: none;
  padding: 0px;
}

.important__table {
  width: 100%;
  margin: 0px;
}

.important__table th,
.important__table td {
  padding: 8px 0px;
  font-size: 1.4rem;
  font-weight: normal;
  vertical-align: top;
}

.important__table th a,
.important__table td a {
  color: rgb(172, 39, 65);
}

.important__date {
  padding-right: 20px !important;
}

.content--top .section__inner {
  width: 1260px;
  padding: 0px 30px;
  margin: auto;
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
}

.sectionTitle {
  font-size: 4.2rem;
  line-height: 1.4;
  font-weight: bold;
  text-align: center;
  margin-bottom: 125px;
  border: none;
  padding: 0px;
}

.sectionTitle:before {
  display: none;
}

.sectionTitle span {
  position: relative;
  font-size: 40px;
  font-weight: 300;
  color: #070707;
  border-bottom: 1px solid #7481d1;
  padding-bottom: 10px;
}

@media screen and (max-width: 767px) {
  .sectionTitle span {
    font-size: 6.3466666667vw !important;
  }
}

.sectionTitle span:after {
  position: absolute;
  content: "feature";
  font-size: 24px;
  font-weight: 300;
  bottom: -39px;
  font-family: "Barlow", "Tangerine", sans-serif;
  left: 50%;
  -webkit-transform: translateX(-50%);
  transform: translateX(-50%);
  color: #7481d1;
}

.js-slider-w100 {
  margin-bottom: 140px !important;
}

.js-slider-w100 .slick-arrow.slick-prev {
  left: -55px !important;
}

@media screen and (max-width: 767px) {
  .js-slider-w100 .slick-arrow.slick-prev {
    left: -10px !important;
  }
}

.js-slider-w100 .slick-arrow.slick-next {
  right: -55px !important;
}

@media screen and (max-width: 767px) {
  .js-slider-w100 .slick-arrow.slick-next {
    right: -10px !important;
  }
}

.js-slider-w100 .slick-slide {
  margin-right: 5px !important;
  margin-left: 5px !important;
}

@media screen and (max-width: 767px) {
  .js-slider-w100 .slick-slide {
    margin-right: 0 !important;
    margin-left: 0 !important;
  }
}

.section#banner .bannerSlide {
  margin-bottom: 60px;
}

.section#banner .bannerSlide div {
  text-align: center;
}

.section#banner .bannerSlide div a {
  width: 100%;
  vertical-align: bottom;
}

.section#banner .slick-arrow {
  font-size: 0px;
  background: url("../img/module/btn-slidearrow@2x.png") center center/cover no-repeat;
  width: 40px;
  height: 40px;
  margin: 0px;
  padding: 0px;
  position: absolute;
  top: 50%;
  z-index: 1;
}

.section#banner .slick-arrow.slick-prev {
  left: -10px;
  -webkit-transform: translate(-25%, -50%);
  transform: translate(-25%, -50%);
}

.section#banner .slick-arrow.slick-next {
  right: -10px;
  -webkit-transform: translate(25%, -50%) rotate(180deg);
  transform: translate(25%, -50%) rotate(180deg);
}

.section#banner .slick-dots {
  margin: 0px;
  padding-top: 20px;
  position: absolute;
  bottom: 0px;
  left: 0px;
  width: 100%;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
  -ms-flex-pack: center;
  justify-content: center;
  -webkit-transform: translateY(100%);
  transform: translateY(100%);
}

.section#banner .slick-dots li {
  line-height: 0;
}

.section#banner .slick-dots li button {
  display: inline-block;
  background: #e0e6f5;
  font-size: 0px;
  width: 9px;
  height: 9px;
  margin: 0px 5px;
  border-radius: 50%;
}

.section#banner .slick-dots li.slick-active button {
  background: #7481d1;
}

.section#pickup {
  padding: 50px 0px 120px;
  background: url("../img/top/bg-pickup.png") center center/100% 100% no-repeat;
}

.section#pickup .pickupList {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: justify;
  -ms-flex-pack: justify;
  justify-content: space-between;
}

.section#pickup .pickupBox {
  text-decoration: none;
  color: rgb(0, 0, 26);
  width: 265px;
}

.section#pickup .pickupBox figure {
  margin: 0px;
  overflow: hidden;
  padding-bottom: 10px;
  padding-right: 10px;
  background: url("../img/top/bg-pickupBox.png") right bottom no-repeat;
}

.section#pickup .pickupBox figure span {
  overflow: hidden;
  max-width: 100%;
  vertical-align: bottom;
}

.section#pickup .pickupBox figure span img {
  -webkit-transition: all 1s ease 0s;
  transition: all 1s ease 0s;
}

.section#pickup .pickupBox__date {
  font-size: 1.2rem;
  font-weight: bold;
  margin: 15px 0px 0px;
}

.section#pickup .pickupBox__text {
  font-size: 1.4rem;
  margin: 0px;
}

.section#pickup .pickupBox:hover img {
  -webkit-transform: scale(1.2);
  transform: scale(1.2);
}

.section#information {
  background: rgba(30, 60, 145, 0.1);
  padding: 100px 0px 120px;
}

.tab__list {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: start;
  -ms-flex-pack: start;
  justify-content: flex-start;
}

.tab__hook {
  color: rgb(30, 60, 145);
  font-size: 1.2rem;
  font-weight: bold;
  width: 130px;
  height: 40px;
  line-height: 37px;
  text-align: center;
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
  background: white;
  border-width: 3px 3px 0px;
  border-top-style: solid;
  border-right-style: solid;
  border-left-style: solid;
  border-top-color: rgb(30, 60, 145);
  border-right-color: rgb(30, 60, 145);
  border-left-color: rgb(30, 60, 145);
  -o-border-image: initial;
  border-image: initial;
  border-bottom-style: initial;
  border-bottom-color: initial;
  position: relative;
  text-decoration: none;
}

.tab__hook::after {
  content: "";
  display: block;
  width: calc(100% + 6px);
  height: 100%;
  background: transparent;
  border-bottom: 3px solid white;
  position: absolute;
  bottom: 0px;
  left: -3px;
}

.tab__hook:not(:first-child) {
  margin-left: 6px;
}

.tab__hook.is-active {
  background: rgb(30, 60, 145);
  color: white;
}

.tab__hook.is-active::after {
  display: none;
}

.tab__content {
  background: white;
  padding: 30px;
  border-top: 3px solid rgb(30, 60, 145);
}

.tab__content:not(.is-active) {
  display: none;
}

.tab__content> :first-child {
  margin-top: 0px;
}

.tab__content> :last-child {
  margin-bottom: 0px;
}

.newsList {
  margin: 0px;
}

.newsList__item {
  margin: 45px 0px;
}

.newsList__item:first-child {
  margin-top: 10px;
}

.newsList__item:last-child {
  margin-bottom: 10px;
}

.newsLink {
  display: table;
  width: 100%;
  color: rgb(0, 0, 26);
  -webkit-transition: all 0.5s ease 0s;
  transition: all 0.5s ease 0s;
}

.newsLink:hover {
  -webkit-box-shadow: rgba(0, 0, 0, 0.2) 0px 0px 20px 0px;
  box-shadow: rgba(0, 0, 0, 0.2) 0px 0px 20px 0px;
  text-decoration: none;
}

.newsLink__figure,
.newsLink__text {
  display: table-cell;
  vertical-align: top;
}

.newsLink .newsLink__figure {
  max-width: 100px;
  width: 100px;
  margin: 0px;
  padding-right: 15px;
}

.newsLink__date {
  font-size: 1.2rem;
  font-weight: bold;
  line-height: 1.4;
  margin-bottom: 5px;
  display: inline-block;
}

.newsLink__label {
  font-size: 1rem;
  line-height: 1.4;
  background: rgb(229, 229, 229);
  color: rgb(30, 60, 145);
  display: inline-block;
  padding: 0.2em 0.8em;
  margin-left: 0.5em;
  -webkit-transform: translateY(-10%);
  transform: translateY(-10%);
}

.newsLink__title {
  font-size: 1.7rem;
  font-weight: bold;
  line-height: 1.4;
  margin-bottom: 8px;
}

.newsLink__head {
  margin-top: -5px;
  position: relative;
}

.newsLink__body {
  font-size: 1.4rem;
  line-height: 1.78571;
}

.btn01 {
  min-width: 280px;
  height: 46px;
  padding: 2px 10px;
  position: relative;
  display: table;
  color: white;
  font-size: 1.4rem;
  font-weight: bold;
  -webkit-transition: all 0.3s ease 0s;
  transition: all 0.3s ease 0s;
  margin: auto;
  text-decoration: none !important;
}

.btn01:hover {
  opacity: 0.75 !important;
}

.btn01 span {
  display: table-cell;
  vertical-align: middle;
  text-align: center;
  position: relative;
  z-index: 1;
  background: url("../img/common/arrow-btn01.png") right 20px center no-repeat;
  padding-right: 1rem;
}

.btn01::before,
.btn01::after {
  content: "";
  display: block;
  width: 100%;
  height: 100%;
  position: absolute;
  -webkit-transform: skewX(-25deg);
  transform: skewX(-25deg);
  z-index: 0;
}

.btn01::before {
  background: rgb(255, 240, 0);
  top: 2px;
  left: 2px;
}

.btn01::after {
  background: rgb(30, 60, 145);
  top: -1px;
  left: -1px;
}

.btn01--back span {
  display: table-cell;
  vertical-align: middle;
  text-align: center;
  position: relative;
  z-index: 1;
  background: url("../img/common/arrow-btn01-back.png") left 20px center no-repeat;
  padding-left: 1rem;
}

.btn01--sis {
  min-width: 350px;
}

.btn01--elementary {
  min-width: 350px;
}

.btn01--hs {
  min-width: 350px;
}

.btn01--jh {
  min-width: 350px;
}

.btn01--seiwa_j_college {
  min-width: 350px;
}

.btn01--kindergarten {
  min-width: 300px;
}

.btn01--kindergarten span {
  background: url("../img/common/arrow-btn01-kindergarten.png") right 20px center no-repeat;
}

.btn01--kindergarten::before,
.btn01--kindergarten::after {
  border-radius: 10px;
  -webkit-transform: skewX(0deg);
  transform: skewX(0deg);
}

#events {
  padding: 110px 0px;
}

.eventList {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: justify;
  -ms-flex-pack: justify;
  justify-content: space-between;
  margin-bottom: 70px;
}

.eventBox {
  max-width: 255px;
  color: black;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: justify;
  -ms-flex-pack: justify;
  justify-content: space-between;
  -webkit-transition: all 0.5s ease 0s;
  transition: all 0.5s ease 0s;
  text-decoration: none !important;
}

.eventBox:hover {
  -webkit-box-shadow: rgba(0, 0, 0, 0.2) 0px 0px 20px 0px;
  box-shadow: rgba(0, 0, 0, 0.2) 0px 0px 20px 0px;
}

.eventBox__date {
  background: rgb(232, 235, 244);
  border-right: 1px solid rgb(0, 0, 26);
  padding: 8px;
  font-weight: bold;
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
}

.eventBox__date>p {
  margin: 0px;
  letter-spacing: 0px;
  line-height: 1.1;
}

.eventBox__date__month {
  font-size: 1.2rem;
}

.eventBox__date__day {
  font-size: 2.4rem;
  -moz-text-align-last: justify;
  text-align-last: justify;
}

.eventBox__date__dotw {
  font-size: 1.2rem;
  -moz-text-align-last: justify;
  text-align-last: justify;
}

.eventBox__detail {
  padding-left: 10px;
}

.eventBox__detail> :first-child {
  margin-top: 0px;
}

.eventBox__detail> :last-child {
  margin-bottom: 0px;
}

.eventBox__label {
  line-height: 1;
  padding: 8px 30px;
  font-weight: bold;
  border: 1px solid rgb(0, 0, 26);
  text-align: center;
  display: inline-block;
  font-size: 1.2rem;
  margin-bottom: 10px;
}

.eventBox__notice {
  color: rgb(172, 39, 65);
  line-height: 1;
  display: inline-block;
  font-size: 1.4rem;
  font-weight: bold;
  margin-bottom: 5px;
}

.eventBox__title {
  margin: 0px 0px 10px;
  font-size: 1.4rem;
  font-weight: bold;
}

.eventBox__address {
  line-height: 1.4;
  font-size: 1.2rem;
  margin: 0px 0px 10px;
  padding-left: 15px;
  background: url("../img/common/icon-place.png") left top no-repeat;
}

.eventBox__target {
  line-height: 1.4;
  font-size: 1.2rem;
  margin: 0px;
  padding-left: 15px;
  background: url("../img/common/icon-target.png") left top no-repeat;
}

#movie {
  background: rgba(30, 60, 145, 0.1);
  padding: 110px 0px 420px;
}

#movie_area {
  width: 100% !important;
}

#movie .videoSlide {
  margin-bottom: 50px !important;
}

#movie .videoSlide iframe {
  vertical-align: bottom;
}

#movie .videoSlide .slick-list {
  overflow: visible;
}

#movie .videoSlide .slick-arrow {
  font-size: 0px;
  background: url("../img/common/btn-slidearrow.png") center center/cover no-repeat;
  width: 40px;
  height: 40px;
  margin: 0px;
  padding: 0px;
  position: absolute;
  top: 50%;
  z-index: 1;
}

#movie .videoSlide .slick-arrow.slick-prev {
  left: 0px;
  -webkit-transform: translate(-50%, -50%);
  transform: translate(-50%, -50%);
}

#movie .videoSlide .slick-arrow.slick-next {
  right: 0px;
  -webkit-transform: translate(50%, -50%) rotate(180deg);
  transform: translate(50%, -50%) rotate(180deg);
}

#movie .videoSlide .slick-dots {
  margin: 0px;
  padding-top: 20px;
  position: absolute;
  bottom: 0px;
  left: 0px;
  width: 100%;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
  -ms-flex-pack: center;
  justify-content: center;
  -webkit-transform: translateY(100%);
  transform: translateY(100%);
}

#movie .videoSlide .slick-dots li button {
  background: white;
  font-size: 0px;
  width: 37px;
  height: 13px;
  margin: 0px 6px;
}

#movie .videoSlide .slick-dots li.slick-active button {
  background: rgb(255, 240, 0);
}

#highscool {
  background: url("../img/top/bg-highscool.jpg") center bottom/cover no-repeat;
  padding: 0px 0px 60px;
  margin-top: -215px;
  text-align: center;
  -webkit-box-shadow: rgba(0, 0, 0, 0.4) 0px 0.5rem 0.5rem -0.5rem;
  box-shadow: rgba(0, 0, 0, 0.4) 0px 0.5rem 0.5rem -0.5rem;
  position: relative;
  z-index: 0;
}

#highscool a {
  margin-top: -100px;
}

#highscool a img {
  display: inline-block;
}

#recomend-banner {
  background: white;
  padding: 25px 0px;
}

#recomend-banner .bnrs {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
  -ms-flex-pack: center;
  justify-content: center;
  -webkit-box-align: center;
  -ms-flex-align: center;
  align-items: center;
}

#recomend-banner .bnr {
  margin: 0px 60px;
}

.lead {
  font-size: 1.7rem;
  margin-bottom: 60px;
}

.indexBox {
  padding-bottom: 35px;
  position: relative;
  display: block;
  -webkit-transition: all 0.5s ease 0s;
  transition: all 0.5s ease 0s;
  text-decoration: none !important;
}

.indexBox::after {
  content: "";
  display: block;
  clear: both;
}

.indexBox__figure {
  float: left;
  width: 200px;
  margin: 0px;
}

.indexBox__text {
  padding-left: 220px;
  margin: 0px;
  color: rgb(0, 0, 26);
}

.indexBox__text dt {
  font-size: 2.1rem;
  font-weight: bold;
  color: rgb(30, 60, 145);
}

.indexBox__text dt+dd {
  margin-top: 10px;
}

.indexBox__btn {
  background: rgb(30, 60, 145);
  padding: 0.2em 1em 0.3em;
  color: white;
  position: absolute;
  bottom: 0px;
  right: 0px;
  font-size: 1.2rem;
}

.indexBox:hover {
  -webkit-box-shadow: rgba(0, 0, 0, 0.2) 0px 0px 20px 0px;
  box-shadow: rgba(0, 0, 0, 0.2) 0px 0px 20px 0px;
  text-decoration: none;
}

.eventList {
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  margin-bottom: 20px;
}

.eventList--border .eventBox {
  margin-bottom: 60px;
  position: relative;
}

.eventList--border .eventBox::after {
  content: "";
  display: block;
  width: 100%;
  height: 1px;
  background: rgb(232, 235, 244);
  position: absolute;
  bottom: -30px;
  left: 0px;
}

.eventList--border .eventBox:nth-child(n+5) {
  margin-top: 30px;
}

.eventList+.pagenation {
  margin-top: 0px;
}

.selectYearWrap::after {
  content: "";
  display: block;
  clear: both;
}

.selectYear {
  float: right;
  margin-bottom: 20px;
  font-size: 1.2rem;
  position: relative;
}

.selectYear a {
  color: rgb(0, 0, 26);
  text-decoration: none !important;
}

.selectYear__hook {
  padding-right: 1.5em;
  position: relative;
}

.selectYear__hook::after {
  content: "";
  display: block;
  width: 0px;
  height: 0px;
  border-style: solid;
  border-width: 8px 5px 0px;
  border-color: rgb(0, 0, 26) transparent transparent;
  position: absolute;
  top: 50%;
  right: 0px;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
  -webkit-transition: all 0.3s ease 0s;
  transition: all 0.3s ease 0s;
}

.selectYear__hook.is-open::after {
  -webkit-transform: translateY(-50%) rotate(180deg);
  transform: translateY(-50%) rotate(180deg);
}

.selectYear__cont {
  position: absolute;
  bottom: 0px;
  right: 0px;
  -webkit-transform: translateY(100%);
  transform: translateY(100%);
  background: white;
  -webkit-box-shadow: rgba(0, 0, 0, 0.2) 0px 0px 1rem 0px;
  box-shadow: rgba(0, 0, 0, 0.2) 0px 0px 1rem 0px;
  min-width: 100%;
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
  text-align: center;
  overflow: hidden;
  max-height: 0px;
  -webkit-transition: all 0.3s ease 0s;
  transition: all 0.3s ease 0s;
}

.selectYear__cont a {
  display: block;
  padding: 0.5em 1.5em;
  -webkit-transition: all 0.3s ease 0s;
  transition: all 0.3s ease 0s;
}

.selectYear__cont a:hover {
  background: rgb(232, 235, 244);
}

.selectYear__cont.is-open {
  max-height: 10rem;
}

.block {
  margin: 50px 0px;
}

.articleTitle {
  padding: 0px 0px 15px;
  border-bottom: 4px solid rgb(229, 229, 229);
  font-weight: bold;
  font-size: 2.8rem;
  margin-top: 85px;
  position: relative;
}

.articleTitle__label {
  font-weight: normal;
  font-size: 1rem;
  padding: 0.5em 1em;
  background: rgb(229, 229, 229);
  -webkit-transform: translateY(-10px);
  transform: translateY(-10px);
  line-height: 1;
  color: rgb(30, 60, 145);
}

.articleTitle__label2 {
  font-weight: normal;
  font-size: 1.2rem;
  padding: 7px 30px;
  border: 1px solid rgb(0, 0, 26);
  -webkit-transform: translateY(-10px);
  transform: translateY(-10px);
  line-height: 1;
  margin-bottom: 10px;
}

.articleTitle__date {
  font-size: 1.2rem;
  font-weight: normal;
  margin-left: 10px;
  -webkit-transform: translateY(-10px);
  transform: translateY(-10px);
  line-height: 1;
}

.articleTitle::after {
  content: "";
  display: block;
  width: 100px;
  height: 4px;
  background: rgb(30, 60, 145);
  position: absolute;
  bottom: -4px;
  left: 0px;
}

.social {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: end;
  -ms-flex-pack: end;
  justify-content: flex-end;
  margin-top: 10px;
  margin-bottom: 20px;
}

.social__btn {
  margin-left: 5px;
}

.sectionTitle2 {
  text-align: left;
  font-size: 2.1rem;
  color: rgb(30, 60, 145);
  font-weight: bold;
  letter-spacing: 0.1em;
}

.blockTitle {
  font-size: 1.7rem;
  font-weight: bold;
  margin-bottom: 10px;
}

.evendDescription {
  font-weight: bold;
  padding-bottom: 50px;
  margin-bottom: 50px;
  border-bottom: 1px solid rgb(229, 229, 229);
}

.evendDescription::after {
  content: "";
  display: block;
  clear: both;
}

.evendDescription dt {
  float: left;
}

table[class^=table] {
  border-collapse: separate;
  border-spacing: 0.1em;
  background: rgb(229, 229, 229);
}

table[class^=table] th {
  background: rgb(243, 243, 243);
  padding: 25px;
}

table[class^=table] td {
  background: white;
  padding: 25px;
  font-weight: 300;
}

table[class^=table] th> :first-child,
table[class^=table] td> :first-child {
  margin-top: 0px;
}

table[class^=table] th> :last-child,
table[class^=table] td> :last-child {
  margin-bottom: 0px;
}

.table th {
  background: rgb(250, 250, 250);
}

.table td {
  background: white;
}

.table a {
  text-align: center;
  font-size: 1rem;
  color: #7481D1;
}

.table02 thead th {
  background: rgb(250, 250, 250);
}

.table02 tbody th {
  font-weight: bold;
  background: white;
  text-align: left;
}

.table02 tbody td {
  background: white;
}

.table03 {
  border-collapse: collapse;
  border-spacing: 0px;
  border: 1px solid rgb(229, 229, 229);
}

.table03 th,
.table03 td {
  border-bottom: 1px solid rgb(229, 229, 229);
}

.table03 th {
  background: rgb(250, 250, 250);
  text-align: left;
  vertical-align: middle;
}

.note {
  font-size: 1rem;
  font-weight: 300;
}

.section#news {
  background: rgba(30, 60, 145, 0.1);
}

#sis .section#news {
  padding-top: 100px;
  padding-bottom: 120px;
}

#elementary .section#news {
  padding-top: 100px;
  padding-bottom: 120px;
}

#jh .section#news {
  padding-top: 100px;
  padding-bottom: 120px;
}

#hs .section#news {
  padding-top: 100px;
  padding-bottom: 120px;
}

#seiwa_j_college .section#news {
  padding-top: 100px;
  padding-bottom: 120px;
}

#kindergarten .section#news {
  padding-top: 100px;
  padding-bottom: 120px;
}

.borderBox {
  border-top: 3px solid rgb(30, 60, 145);
  padding: 30px;
  background: white;
}

.indexBox2 {
  -webkit-box-shadow: rgb(255, 240, 0) 3px 3px 0px 0px;
  box-shadow: rgb(255, 240, 0) 3px 3px 0px 0px;
  background: rgb(30, 60, 145);
  text-decoration: none !important;
}

.indexBox2__figure {
  margin: 0px;
  overflow: hidden;
}

.indexBox2__figure img {
  -webkit-transition: all 1s ease 0s;
  transition: all 1s ease 0s;
}

.indexBox2__text {
  margin: 0px;
  text-align: center;
  color: white;
  font-size: 2.1rem;
  font-weight: bold;
  display: table;
  width: 100%;
  height: 118px;
}

.indexBox2__text>span {
  display: table-cell;
  vertical-align: middle;
}

.indexBox2:hover img {
  -webkit-transform: scale(1.2);
  transform: scale(1.2);
}

#btnarea {
  padding: 80px 0px;
  margin-bottom: 60px;
}

.btns {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
  -ms-flex-pack: center;
  justify-content: center;
}

.btns>* {
  margin: 0px 30px;
}

.largeBtn {
  min-width: 570px;
  height: 190px;
  padding: 2px 10px;
  position: relative;
  display: table;
  color: white;
  font-size: 4.2rem;
  font-weight: bold;
  -webkit-transition: all 0.3s ease 0s;
  transition: all 0.3s ease 0s;
  text-decoration: none !important;
}

.largeBtn:hover {
  opacity: 0.75 !important;
}

.largeBtn span {
  display: table-cell;
  vertical-align: middle;
  text-align: center;
  position: relative;
  z-index: 1;
  background: url("../img/common/arrow-largeBtn-kindergarten.png") right 30px center no-repeat;
  padding-right: 1rem;
}

.largeBtn::before,
.largeBtn::after {
  content: "";
  display: block;
  width: 100%;
  height: 100%;
  position: absolute;
  z-index: 0;
  border-radius: 10px;
}

.largeBtn::before {
  background: rgb(255, 240, 0);
  top: 3px;
  left: 3px;
}

.largeBtn::after {
  background: rgb(30, 60, 145);
  top: -2px;
  left: -2px;
}

@media only screen and (min-width: 768px) {
  .is-sp {
    display: none !important;
  }
}

@media only screen and (max-width: 767px) {
  .is-pc {
    display: none !important;
  }
}

a,
span {
  display: inline-block;
}

a>img {
  -webkit-transition: opacity 0.3s ease 0s;
  transition: opacity 0.3s ease 0s;
}

a:hover>img {
  opacity: 0.65;
}

img {
  max-width: 100%;
}

body {
  margin: 0px;
}

body.is-open {
  position: fixed;
}

img[src*=icon-] {
  vertical-align: middle;
}

.mv {
  font-size: 0px;
  background-size: cover !important;
}

.js-sticky.is-fixed {
  position: fixed;
  top: 0px;
  left: 0px;
  z-index: 10000;
  width: 100%;
  -webkit-transform: translateY(-120%);
  transform: translateY(-120%);
  -webkit-box-shadow: rgba(0, 0, 0, 0.1) 0px 0px 2rem;
  box-shadow: rgba(0, 0, 0, 0.1) 0px 0px 2rem;
}

.js-sticky.is-show {
  -webkit-transition: all 1s ease 0s;
  transition: all 1s ease 0s;
  -webkit-transform: translateY(0px);
  transform: translateY(0px);
}

.js-slideIn {
  -webkit-transition: all 0.8s ease 0s;
  transition: all 0.8s ease 0s;
  -webkit-transform: translateY(30px);
  transform: translateY(30px);
  opacity: 0;
}

.js-slideIn.is-slide {
  opacity: 1;
  -webkit-transform: translateY(0px);
  transform: translateY(0px);
}

.header {
  background: white;
  margin: auto;
  min-width: 1260px;
}

.header .header__primary {
  padding: 0px 0px 0px 40px;
  background: rgb(30, 60, 145);
}

.header__utility {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: end;
  -ms-flex-pack: end;
  justify-content: flex-end;
  -webkit-box-align: center;
  -ms-flex-align: center;
  align-items: center;
  font-size: 1.2rem;
  padding-left: 250px;
}

.header__utility a {
  color: white;
  padding: 0px 10px;
}

.header__utility>* {
  height: 36px;
  line-height: 36px;
}

.header__languages {
  position: relative;
}

.header__languages__list {
  position: absolute;
  bottom: 0px;
  right: 0px;
  -webkit-transform: translateY(100%);
  transform: translateY(100%);
}

.header__langages__hook {
  position: relative;
  padding-right: 2em !important;
}

.header__langages__hook::after {
  content: "";
  display: block;
  width: 0px;
  height: 0px;
  border-style: solid;
  border-width: 0.6em 0.3em 0px;
  border-color: white transparent transparent;
  position: absolute;
  top: 50%;
  right: 1em;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
  transition: transform 0.3s ease 0s, -webkit-transform 0.3s ease 0s;
}

.header__langages__hook.is-open::after {
  -webkit-transform: translateY(-50%) rotate(180deg);
  transform: translateY(-50%) rotate(180deg);
}

.header__languages__list {
  max-height: 0px;
  background: rgb(30, 60, 145);
  z-index: 1;
  -webkit-box-shadow: rgba(0, 0, 0, 0.2) 0px 0px 0.2rem 0px;
  box-shadow: rgba(0, 0, 0, 0.2) 0px 0px 0.2rem 0px;
  overflow: hidden;
  -webkit-transition: max-height 0.3s ease 0s;
  transition: max-height 0.3s ease 0s;
}

.header__languages__list.is-open {
  max-height: 100em;
}

.header__school {
  position: relative;
}

.header__school__hook {
  position: relative;
  padding-right: 2em !important;
}

.header__school__hook::after {
  content: "";
  display: block;
  width: 0px;
  height: 0px;
  border-style: solid;
  border-width: 0.6em 0.3em 0px;
  border-color: white transparent transparent;
  position: absolute;
  top: 50%;
  right: 1em;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
  transition: transform 0.3s ease 0s, -webkit-transform 0.3s ease 0s;
}

.header__school__hook.is-open::after {
  -webkit-transform: translateY(-50%) rotate(180deg);
  transform: translateY(-50%) rotate(180deg);
}

.header__school__list {
  position: absolute;
  bottom: 0px;
  right: 0px;
  -webkit-transform: translateY(100%);
  transform: translateY(100%);
  max-height: 0px;
  background: rgb(30, 60, 145);
  z-index: 100000;
  -webkit-box-shadow: rgba(0, 0, 0, 0.2) 0px 0px 0.2rem 0px;
  box-shadow: rgba(0, 0, 0, 0.2) 0px 0px 0.2rem 0px;
  overflow: hidden;
  -webkit-transition: max-height 0.3s ease 0s;
  transition: max-height 0.3s ease 0s;
  white-space: nowrap;
}

.header__school__list a {
  display: block;
}

.header__school__list.is-open {
  max-height: 100em;
}

.header .search {
  border-left: 1px solid white;
  border-right: 1px solid white;
  padding: 0px;
  position: relative;
}

.header .search__hook {
  padding: 0px 10px;
  position: relative;
}

.header .search__hook::after {
  content: "";
  display: block;
  width: 0px;
  height: 0px;
  border-style: solid;
  border-width: 0px 5px 8px;
  border-color: transparent transparent rgb(255, 255, 255);
  position: absolute;
  top: 50%;
  left: 50%;
  -webkit-transform: translate(-50%, -50%);
  transform: translate(-50%, -50%);
  opacity: 0;
}

.header .search__hook.is-open img {
  opacity: 0;
}

.header .search__hook.is-open::after {
  opacity: 1;
}

.header .search__cont {
  position: absolute;
  bottom: 0px;
  right: -1px;
  -webkit-transform: translateY(100%);
  transform: translateY(100%);
  background: white;
  z-index: 10;
  border-width: 0px 1px 1px;
  border-right-style: solid;
  border-bottom-style: solid;
  border-left-style: solid;
  border-right-color: rgb(229, 229, 229);
  border-bottom-color: rgb(229, 229, 229);
  border-left-color: rgb(229, 229, 229);
  -o-border-image: initial;
  border-image: initial;
  border-top-style: initial;
  border-top-color: initial;
  -webkit-box-shadow: rgba(0, 0, 0, 0.2) 0px 0.2rem 0.4rem 0px;
  box-shadow: rgba(0, 0, 0, 0.2) 0px 0.2rem 0.4rem 0px;
  display: none;
}

.header .search__cont.is-open {
  display: block;
}

.header .search__cont form {
  position: relative;
  background: rgb(30, 60, 145);
  width: 30rem;
}

.header .search__cont form input[type=text] {
  vertical-align: top;
  margin: 0px;
  background: white;
  height: 3.9rem !important;
  width: calc(100% - 34px) !important;
  border: none !important;
}

.header .search__cont form input[type=image] {
  position: absolute;
  right: 1rem;
  top: 50%;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
  margin: 0px;
  z-index: 1;
}

.header .search__cont * {
  margin: 0px;
}

.header a.contact {
  background: rgb(255, 240, 0);
  color: rgb(0, 0, 26);
}

.header__secondary {
  border-bottom: 1px solid rgb(229, 229, 229);
  padding: 8px 40px;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: justify;
  -ms-flex-pack: justify;
  justify-content: space-between;
  -webkit-box-align: center;
  -ms-flex-align: center;
  align-items: center;
  position: relative;
}

.header__logo {
  margin-top: -45px;
  margin-bottom: -5px;
  background: white;
  padding-left: 50%;
  margin-left: calc(-50% - 60px);
  width: 280px;
}

.header__nav {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: end;
  -ms-flex-pack: end;
  justify-content: flex-end;
  -webkit-box-align: center;
  -ms-flex-align: center;
  align-items: center;
}

.header__nav a {
  margin: 0px 10px;
  font-size: 1.2rem;
  font-weight: bold;
  color: rgb(0, 0, 26);
}

.header--elementary .header__logo {
  width: 300px;
}

.header--jh .header__logo {
  width: 300px;
}

.header--hs .header__logo {
  width: 300px;
}

.header--seiwa_j_college .header__logo {
  width: 300px;
}

.footer {
  margin: auto;
  background-image: url("../img/common/bg-footer.jpg");
  background-position: center center;
  background-repeat: no-repeat;
  background-attachment: initial;
  background-origin: initial;
  background-clip: initial;
  background-color: initial;
  color: white;
  background-size: cover !important;
}

.footer a {
  color: white;
}

.footer__inner {
  padding: 60px;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: justify;
  -ms-flex-pack: justify;
  justify-content: space-between;
  -webkit-box-align: end;
  -ms-flex-align: end;
  align-items: flex-end;
}

.footer__primary {
  text-align: center;
}

.footer__secondaly {
  text-align: right;
}

.footer .footer__snsList {
  margin: 30px 0px;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
  -ms-flex-pack: center;
  justify-content: center;
}

.footer .footer__sns {
  margin: 0px 10px;
}

.footer__address {
  font-size: 1.2rem;
}

.footer .footer__nav {
  margin-top: 15px;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: end;
  -ms-flex-pack: end;
  justify-content: flex-end;
}

.footer .footer__nav__item {
  font-size: 1.2rem;
}

.footer .footer__nav__item:not(:first-child) {
  position: relative;
  padding-left: 2em;
}

.footer .footer__nav__item:not(:first-child)::before {
  content: "/";
  display: inline-block;
  position: absolute;
  left: 0.5em;
  top: 50%;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
}

.footer__copyright {
  font-size: 1.2rem;
  font-weight: bold;
  margin-top: 30px;
}

.footer--sis .footer__address {
  margin-top: 30px;
}

.footer--elementary .footer__address {
  margin-top: 30px;
}

.footer--jh .footer__address {
  margin-top: 30px;
}

.footer--hs .footer__address {
  margin-top: 30px;
}

.footer--seiwa_j_college .footer__inner {
  -webkit-box-align: center;
  -ms-flex-align: center;
  align-items: center;
}

.footer--seiwa_j_college .footer__address .footer__sns {
  margin-top: 0px;
  margin-right: 20px;
  margin-left: 0px;
}

.footer--seiwa_j_college .footer__address p {
  margin: 0px;
}

.footer--kindergarten .footer__address {
  margin-top: 10px;
  text-align: left;
}

.footer--kindergarten .footer__address .footer__sns {
  float: left;
  margin-top: 5px;
  margin-right: 20px;
  margin-left: 20px;
}

.footer--kindergarten .footer__copyright {
  margin-top: 60px;
}

.footer>.btnPageTop {
  position: relative;
}

.footer>.btnPageTop .btnPageTop__hook {
  background: white;
  width: 40px;
  height: 40px;
  text-align: center;
  border: 2px solid rgb(30, 60, 145);
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
  font-size: 0rem;
  -webkit-transition: opacity 0.3s ease 0s;
  transition: opacity 0.3s ease 0s;
}

.footer>.btnPageTop .btnPageTop__hook>span {
  padding-top: 28px;
  position: relative;
}

.footer>.btnPageTop .btnPageTop__hook>span::before {
  content: "";
  display: block;
  width: 14px;
  height: 14px;
  border-top: 2px solid rgb(30, 60, 145);
  border-left: 2px solid rgb(30, 60, 145);
  position: absolute;
  top: 50%;
  left: 50%;
  -webkit-transform: translateX(-50%) rotate(45deg);
  transform: translateX(-50%) rotate(45deg);
}

.footer>.btnPageTop .btnPageTop__hook:hover {
  opacity: 0.65;
}

.footer>.btnPageTop .btnPageTop__hook:not(.is-fixed) {
  position: absolute;
  top: -30px;
  right: 20px;
  -webkit-transform: translateY(-100%);
  transform: translateY(-100%);
}

.footer>.btnPageTop .btnPageTop__hook.is-fixed {
  position: fixed;
  bottom: 30px;
  right: 20px;
}

p,
ul,
dl,
table,
figure {
  margin: 20px 0px;
}

a {
  text-decoration: none;
}

a:hover {
  text-decoration: underline;
}

.hero {
  overflow: hidden;
  position: relative;
  z-index: 0;
  max-width: 1200px;
  height: 606px;
  margin: auto;
}

.hero__title {
  position: absolute;
  top: 50%;
  left: 0px;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
  z-index: 10;
}

.hero__logo {
  position: absolute;
  top: 50%;
  left: 50%;
  -webkit-transform: translate(-50%, -50%);
  transform: translate(-50%, -50%);
  z-index: 10;
  text-align: center;
}

@media only screen and (min-width: 768px) {
  .hero__logo {
    margin-top: -10px;
  }
}

.hero__bg {
  position: absolute;
  z-index: 0;
  inset: 0px;
  overflow: hidden;
  width: 100%;
  height: 100%;
}

.hero__bg__inner {
  position: relative;
  overflow: hidden;
  height: 100%;
}

.hero__bg__list {
  height: 100%;
}

.hero__bg__list__inner {
  position: relative;
  top: 0px;
  left: 0px;
  width: 100%;
  height: 100%;
}

.hero__bg__item {
  position: absolute;
  z-index: -1;
  top: 0px;
  left: 0px;
  display: none;
  overflow: hidden;
  width: 100%;
  height: 100%;
  -webkit-transform: translate3d(0px, 0px, 0px) rotate(0.0001deg) scale3d(1, 1, 1);
  transform: translate3d(0px, 0px, 0px) rotate(0.0001deg) scale3d(1, 1, 1);
  background: center center/cover rgb(49, 49, 49);
}

.hero__bg__item.is-active {
  display: block;
}

.hero__navs {
  position: absolute;
  bottom: 20px;
  left: 150px;
  width: 160px;
}

.hero__navs__inner {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: justify;
  -ms-flex-pack: justify;
  justify-content: space-between;
  position: relative;
}

.hero__nav {
  color: rgb(0, 26, 83);
  font-weight: bold;
  -webkit-transition: all 0.5s ease 0s;
  transition: all 0.5s ease 0s;
}

.hero__nav.is-active {
  -webkit-transform: translateY(-20px);
  transform: translateY(-20px);
}

.hero__nav span {
  position: relative;
}

.hero__nav span::before {
  content: "";
  display: block;
  width: 1px;
  height: 40px;
  background: rgb(0, 26, 83);
  position: absolute;
  bottom: 0px;
  left: 50%;
  -webkit-transform: translate(-50%, 100%);
  transform: translate(-50%, 100%);
}

@-webkit-keyframes scaleUp {
  0% {
    -webkit-transform: translate3d(0px, 0px, 0px) rotate(0.0001deg) scale3d(1, 1, 1);
    transform: translate3d(0px, 0px, 0px) rotate(0.0001deg) scale3d(1, 1, 1);
  }

  100% {
    -webkit-transform: translate3d(0px, 0px, 0px) rotate(0.0001deg) scale3d(1.7, 1.7, 1.7);
    transform: translate3d(0px, 0px, 0px) rotate(0.0001deg) scale3d(1.7, 1.7, 1.7);
  }
}

@keyframes scaleUp {
  0% {
    -webkit-transform: translate3d(0px, 0px, 0px) rotate(0.0001deg) scale3d(1, 1, 1);
    transform: translate3d(0px, 0px, 0px) rotate(0.0001deg) scale3d(1, 1, 1);
  }

  100% {
    -webkit-transform: translate3d(0px, 0px, 0px) rotate(0.0001deg) scale3d(1.7, 1.7, 1.7);
    transform: translate3d(0px, 0px, 0px) rotate(0.0001deg) scale3d(1.7, 1.7, 1.7);
  }
}

.clearfix::after {
  display: block;
  clear: both;
  height: 0px;
  content: ".";
  overflow: hidden;
}

.clearfix {
  zoom: 1;
}

.color-red {
  color: #fb3369;
}

.color-green {
  color: #3cc1bb;
}

.color-blue {
  color: #3f8cd9;
}

.color-blue-dark {
  color: #1e3c91;
}

.color-purple {
  color: #380096;
}

.color-red-01 {
  color: #c10435;
}

.paragraph {
  clear: both;
  overflow: hidden;
  margin-bottom: 50px;
}

.image_right img,
.image_left img,
.image_top img,
.image_bottom img {
  max-width: 100%;
}

.image_right,
.image_left,
.image_top,
.image_bottom {
  margin: 1em auto;
  max-width: 100%;
  text-align: center;
}

.image_left {
  margin: 1em auto 1em 0 !important;
}

.image_right {
  margin: 1em 0 1em auto !important;
}

.sns li {
  float: left;
  overflow: hidden;
  margin: 0px 20px 0px 0px;
}

.sns li:nth-child(2) {
  width: 90px;
}

.sns li:nth-child(3) {
  width: 60px;
}

.sns li:nth-child(4) img {
  vertical-align: top;
}

.fb_iframe_widget span {
  vertical-align: top !important;
}

.font-s_05 {
  font-size: 0.5em;
}

.font-s_06 {
  font-size: 0.6em;
}

.font-s_07 {
  font-size: 0.7em;
}

.font-s_08 {
  font-size: 0.8em;
}

.font-s_09 {
  font-size: 0.9em;
}

.font-l_01 {
  font-size: 1.1em;
}

.font-l_02 {
  font-size: 1.2em;
}

.font-l_03 {
  font-size: 1.3em;
}

.font-l_04 {
  font-size: 1.4em;
}

.font-l_05 {
  font-size: 1.5em;
}

.font-l_06 {
  font-size: 1.6em;
}

.font-l_07 {
  font-size: 1.7em;
}

.font-l_08 {
  font-size: 1.8em;
}

.font-l_09 {
  font-size: 1.9em;
}

.font-l_10 {
  font-size: 2em;
}

.font-l_11 {
  font-size: 2.3em;
}

.font-l_12 {
  font-size: 2.9em;
}

.font-size-mini {
  font-size: 0.9em;
}

h4.blockTitle {
  font-size: 1.6rem;
}

h5.blockTitle {
  font-size: 1.5rem;
}

@media print,
screen and (min-width: 481px) {
  .image_right {
    float: right;
    margin: 0px 0px 0px 30px;
    max-width: 400px;
  }

  .image_left {
    float: left;
    margin: 0px 30px 0px 0px;
    max-width: 400px;
  }
}

.sectionTitle2+.blockTitle {
  margin-top: 1.5rem;
}

:not(.sectionTitle2)+.blockTitle {
  margin-top: 4rem;
}

#editor,
#editor_date {
  margin-bottom: 2rem;
}

.index {
  margin: 1rem 0px;
}

.index p {
  margin: 0px 0px 0.5rem;
}

.index #index_box {
  border: 1px solid gray;
  padding: 1rem;
}

.index #index_box ul {
  letter-spacing: -0.5em;
  margin: 0px;
}

.index #index_box ul li {
  letter-spacing: normal;
  display: inline-block;
  margin: 0.5rem 0px;
}

.index #index_box ul li:not(:last-child) {
  margin-right: 2rem;
}

.index #index_box ul li a {
  position: relative;
  color: rgb(0, 0, 26);
  padding-left: 1.5em;
}

.index #index_box ul li a::before {
  content: "";
  display: block;
  width: 0px;
  height: 0px;
  border-style: solid;
  border-width: 0.3em 0px 0.3em 0.35em;
  border-color: transparent transparent transparent rgb(0, 0, 26);
  position: absolute;
  top: 0.6em;
  left: 0.5em;
}

#elementary .mv {
  background: url("../img/elementary/mv.jpg") center center no-repeat;
}

#hs .mv,
#hs_english .mv {
  background: url("../img/hs/mv.jpg") center center no-repeat;
}

#jh .mv {
  background: url("../img/jh/mv.jpg") center center no-repeat;
}

#kindergarten .mv {
  background: url("../img/kindergarten/mv.jpg") center center no-repeat;
}

#seiwa_j_college .mv {
  background: url("../img/seiwaj/mv.jpg") center center no-repeat;
}

#sis .mv {
  background: url("../img/sis/mv.jpg") center center no-repeat;
}

#kenkyu .mv {
  background: url("../img/kenkyu/mv.jpg") center center no-repeat;
}

#a_affairs .mv {
  background: url("../img/a_affairs/mv.jpg") center center no-repeat;
}

#c_child .mv {
  background: url("../img/c_child/mv.jpg") center center no-repeat;
}

#c_christian .mv {
  background: url("../img/c_christian/mv.jpg") center center no-repeat;
}

#c_cppo .mv {
  background: url("../img/c_cppo/mv.jpg") center center no-repeat;
}

#c_hc .mv {
  background: url("../img/c_hc/mv.jpg") center center no-repeat;
}

#c_hl .mv {
  background: url("../img/c_hl/mv.jpg") center center no-repeat;
}

#c_language .mv {
  background: url("../img/c_language/mv.jpg") center center no-repeat;
}

#c_shuwa .mv {
  background: url("/cms/kwansei_c_shuwa/img/mv.jpg") center center no-repeat;
}

#c_teach .mv {
  background: url("../img/c_teach/mv.jpg") center center no-repeat;
}

#c_volunteer .mv {
  background: url("../img/c_volunteer/mv.jpg") center center no-repeat;
}

#cjle .mv {
  background: url("../img/cjle/mv.jpg") center center no-repeat;
}

#f_health .mv {
  background: url("../img/f_health/mv.jpg") center center no-repeat;
}

#f_sengari .mv {
  background: url("../img/f_sengari/mv.jpg") center center no-repeat;
}

#g_language .mv {
  background: url("../img/g_language/mv.jpg") center center no-repeat;
}

#gender .mv {
  background: url("../img/gender/mv.jpg") center center no-repeat;
}

#giving .mv {
  background: url("../img/giving/mv.jpg") center center no-repeat;
}

#highedu .mv {
  background: url("../img/highedu/mv.jpg") center center no-repeat;
}

#i_asr .mv {
  background: url("../img/i_asr/mv.jpg") center center no-repeat;
}

#i_industrial .mv {
  background: url("/cms/kwansei_i_industrial/img/mv.jpg") center center no-repeat;
}

#kenkyu .mv {
  background: url("../img/kenkyu/mv.jpg") center center no-repeat;
}

#kgac .mv {
  background: url("../img/kgac/mv.jpg") center center no-repeat;
}

#lawschool .mv {
  background: url("../img/lawschool/mv.jpg") center center no-repeat;
}

#nkc .mv {
  background: url("../img/nkc/mv.jpg") center center no-repeat;
}

#r_human .mv {
  background: url("../img/r_human/mv.jpg") center center no-repeat;
}

#s_economics .mv {
  background: url("../img/s_economics/mv.jpg") center center no-repeat;
}

#s_education .mv {
  background: url("../img/s_education/mv.jpg") center center no-repeat;
}

#s_humanities .mv {
  background: url("../img/s_humanities/mv.jpg") center center no-repeat;
}

#s_hws .mv {
  background: url("../img/s_hws/mv.jpg") center center no-repeat;
}

#s_is .mv {
  background: url("../img/s_is/mv.jpg") center center no-repeat;
}

#s_law .mv {
  background: url("../img/s_law/mv.jpg") center center no-repeat;
}

#s_policy .mv {
  background: url("../img/s_policy/mv.jpg") center center no-repeat;
}

#s_sociology .mv {
  background: url("../img/s_sociology/mv.jpg") center center no-repeat;
}

#s_theology .mv {
  background: url("../img/s_theology/mv.jpg") center center no-repeat;
}

#shakairenkei .mv {
  background: url("../img/shakairenkei/mv.jpg") center center no-repeat;
}

#sports .mv {
  background: url("/cms/kwansei_sports/mv.jpg") center center no-repeat;
}

#students .mv {
  background: url("../img/students/mv.jpg") center center no-repeat;
}

#t_marunouchi .mv {
  background: url("../img/t_marunouchi/mv.jpg") center center no-repeat;
}

#unfa .mv {
  background: url("../img/unfa/mv.jpg") center center no-repeat;
}

#c_rcc .mv {
  background: url("../img/c_rcc/mv.jpg") center center no-repeat;
}

#koudai .mv {
  background: url("../img/koudai/mv.jpg") center center no-repeat;
}

#admissions .mv {
  background: url("../img/admissions/mv.jpg") center center no-repeat;
}

#ksc .mv {
  background: url("/cms/kwansei_ksc/img/mv.jpg") center center no-repeat;
}

#wc .mv {
  background: url("/cms/kwansei_wc/img/mv.jpg") center center no-repeat;
}

#elementary .footer {
  background: url("../img/elementary/bg-footer.jpg") center center no-repeat;
}

#hs .footer {
  background: url("../img/hs/bg-footer.jpg") center center no-repeat;
}

#jh .footer {
  background: url("../img/jh/bg-footer.jpg") center center no-repeat;
}

#kindergarten .footer {
  background: url("../img/kindergarten/bg-footer.jpg") center center no-repeat;
}

#seiwa_j_college .footer {
  background: url("../img/seiwaj/bg-footer.jpg") center center no-repeat;
}

#sis .footer {
  background: url("../img/sis/bg-footer.jpg") center center no-repeat;
}

a:hover>img[src*="img-highscool.png"] {
  opacity: 0.8;
}

#jh #pickup-02 {
  background: url("../img/jh/bg-pickup.jpg") center bottom/100% no-repeat;
  padding-bottom: 100px;
}

.pickupBox2 {
  background: white;
  padding: 40px;
  color: rgb(0, 0, 26);
  position: relative;
  -webkit-box-shadow: rgb(255, 240, 0) 10px 10px 0px 0px;
  box-shadow: rgb(255, 240, 0) 10px 10px 0px 0px;
  margin: auto;
  display: block;
  width: 1190px;
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
  -webkit-transition: all 0.3s ease 0s;
  transition: all 0.3s ease 0s;
  text-decoration: none !important;
}

.pickupBox2:hover {
  opacity: 0.9;
}

.pickupBox2:hover img {
  opacity: 1;
}

.pickupBox2::after {
  content: "";
  display: block;
  clear: both;
}

.pickupBox2__logo {
  font-size: 72px;
  font-weight: bold;
  color: rgb(255, 240, 0);
  position: absolute;
  top: -16px;
  left: 0px;
  z-index: 0;
  line-height: 1;
}

.pickupBox2__image {
  float: left;
  position: relative;
  z-index: 1;
}

.pickupBox2__text {
  font-size: 18px;
  margin: 0px 0px 60px 430px;
}

.pickupBox2__btn {
  background: rgb(30, 60, 145);
  color: white;
  font-size: 12px;
  padding: 0.2em 1em;
  position: absolute;
  bottom: 40px;
  right: 40px;
}

div.search__cont input[type=text] {
  margin-top: 0px !important;
  padding-top: 0px !important;
}

.indexBoxRow.row--col3 {
  margin-left: -20px;
  margin-right: -20px;
}

.indexBoxRow.row--col3>.row__col {
  width: calc(33.3333% - 40px);
  max-width: calc(33% - 40px);
}

.indexBoxRow.row--col3 .row__col {
  width: calc(100% - 40px);
  margin-left: 20px;
  margin-right: 20px;
  margin-bottom: 60px;
}

.indexBoxRow.row--col3 .indexBox {
  padding-bottom: 0px;
}

.indexBoxRow.row--col3 .indexBox__figure {
  width: 100px;
}

.indexBoxRow.row--col3 .indexBox__text {
  padding-left: 110px;
  padding-bottom: 35px;
}

.indexBoxRow.row--col3 .indexBox__text dt {
  text-align: left;
}

.indexBoxRow.row--col3 .indexBox__btn {
  font-size: 0px;
  width: 0px;
  height: 0px;
  background: none;
  border-style: solid;
  border-width: 0px 0px 20px 20px;
  border-color: transparent transparent rgb(30, 60, 145);
}

.songList li {
  margin: 20px 0px;
  font-size: 1.7rem;
}

.songList li a {
  color: rgb(0, 0, 26);
  padding-left: 25px;
  position: relative;
}

.songList li a::before {
  content: "";
  display: block;
  width: 15px;
  height: 15px;
  background: url("/cms/kwansei/img/common/icon-song.png") center center/cover no-repeat;
  position: absolute;
  top: 50%;
  left: 0px;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
}

.jasrac {
  font-size: 1.2rem;
  margin-top: -50px;
  -webkit-transform: translateY(-100%);
  transform: translateY(-100%);
  position: relative;
  z-index: -1;
}

.jasrac img {
  margin-left: 10px;
}

.songArea__audio figcaption {
  font-size: 1.7rem;
  font-weight: bold;
  margin-bottom: 25px;
}

.songArea__text {
  margin: 30px 0px;
  line-height: 1.8;
  padding-left: 25px;
  position: relative;
}

.songArea__text__num {
  width: 25px;
  position: absolute;
  left: 0px;
  top: 0px;
}

.btn02 {
  background: rgb(30, 60, 145);
  color: white;
  display: table;
}

.btn02 span {
  padding: 0.5em 1em;
  display: table-cell;
  vertical-align: middle;
  text-align: center;
}

.kv {
  margin-top: -2rem;
  margin-bottom: 60px;
}

.kv img {
  width: 100%;
}

.indexList.row--col3 .row__col:nth-child(3n+1) {
  padding: 0px 25px 0px 0px;
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
}

.indexList.row--col3 .row__col:not(:nth-child(3n+1)) {
  border-left: 1px solid rgb(229, 229, 229);
  padding: 0px 25px;
  margin: 0px;
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
}

.indexList.row--col3 .row__col:nth-child(3n+3) {
  padding-right: 0px;
}

.indexList.row--col3 .row__col:nth-child(n+4) {
  margin-top: 60px;
}

.indexList.row--col3 {
  margin-left: 0px;
  margin-right: 0px;
}

.indexList.row--col3>.row__col {
  width: 33.3333%;
  max-width: 33%;
  margin-left: 0px;
  margin-right: 0px;
  margin-bottom: 0px;
}

.indexBox3 {
  position: relative;
  padding-bottom: 40px;
}

.indexBox3::after {
  content: "";
  display: block;
  clear: both;
}

.indexBox3__image {
  float: left;
}

.indexBox3__text {
  padding-left: 16rem;
  text-align: left;
  margin: 0px;
}

.indexBox3__text dt {
  font-size: 1.65rem;
  line-height: 1.47;
  color: rgb(30, 60, 145);
  font-weight: bold;
  margin-bottom: 15px;
}

.indexBox3__text dd {
  font-size: 1.4rem;
  line-height: 1.78;
}

.indexBox3__btn {
  background: rgb(30, 60, 145);
  color: white;
  font-size: 1.3rem;
  height: 2em;
  line-height: 2em;
  padding: 0px 0.6em;
  position: absolute;
  right: 0px;
  bottom: 0px;
  -webkit-transition: all 0.3s ease 0s;
  transition: all 0.3s ease 0s;
}

.indexBox3__btn[href*=".pdf"] {
  background: rgb(204, 0, 0);
}

.indexBox3__btn:hover {
  opacity: 0.65;
  text-decoration: none;
}

.archiveBox {
  text-align: center;
}

.archiveBox__figure {
  margin: 0px;
}

.archiveBox__text p {
  font-size: 1.7rem;
  font-weight: bold;
  margin: 1.5rem 0px;
}

.archiveBox__btn {
  background: rgb(30, 60, 145);
  color: white;
  font-size: 1.3rem;
  height: 2em;
  line-height: 2em;
  padding: 0px 0.6em;
  -webkit-transition: all 0.3s ease 0s;
  transition: all 0.3s ease 0s;
}

.archiveBox__btn[href*=".pdf"] {
  background: rgb(204, 0, 0);
}

.archiveBox__btn:hover {
  opacity: 0.65;
  text-decoration: none;
}

.acc {
  margin: 0 auto;
  border-top: 1px solid #e0e6f5;
}

.acc:last-of-type {
  border-bottom: 1px solid #e0e6f5;
}

.acc__hook {
  display: block;
  padding: 30px 50px 30px 0px;
  color: #7481d1;
  font-size: 16.8px;
  position: relative;
  text-decoration: none !important;
  line-height: 1.1904761905;
}

.acc__hook::before,
.acc__hook::after {
  content: "";
  display: block;
  width: 20px;
  height: 2px;
  background: #7481d1;
  position: absolute;
  right: 15px;
  top: 50%;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
}

.acc__hook::before {
  -webkit-transform: translateY(-50%) rotate(90deg);
  transform: translateY(-50%) rotate(90deg);
  -webkit-transition: all 0.3s ease 0s;
  transition: all 0.3s ease 0s;
}

.acc__hook.is-open::before {
  -webkit-transform: translateY(-50%) rotate(0deg);
  transform: translateY(-50%) rotate(0deg);
}

.acc__cont {
/*  max-height: 0px;*/
/*  overflow: hidden;*/
/*  -webkit-transition: all 0.3s ease 0s;*/
/*  transition: all 0.3s ease 0s;*/
}

.acc__cont__inner {
  font-size: 14px;
  font-weight: 300;
  line-height: 1.7;
}

.acc__cont .table {
  margin: 0;
}

.acc__cont-links {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: vertical;
  -webkit-box-direction: normal;
  -ms-flex-direction: column;
  flex-direction: column;
  gap: 30px;
}

.acc__cont-links p {
  margin: 0;
}

.acc__cont-links .linkBox {
  margin-bottom: 0;
}

.acc__cont-links .link-small {
  margin-bottom: 0;
}

.acc.is-open {
  padding-bottom: 30px;
}

.acc__cont.is-open {
/*  max-height: 100vh;*/
}

.acc__cont__inner> :first-child {
  margin-top: 0px;
}

.acc__cont__inner> :last-child {
  margin-bottom: 0px;
}

.faq__q {
  display: inline-block;
  padding-left: 1.5em;
  position: relative;
}

.faq__q::before {
  content: "Q.";
  display: inline-block;
  width: 1.5em;
  text-indent: -1.5em;
  color: #7481d1;
  position: absolute;
}

.faq__a {
  display: block;
  position: relative;
  text-indent: 1.5em;
}

.faq__a::before {
  content: "A.";
  display: inline-block;
  width: 1.5em;
  color: #fb3369;
  position: absolute;
  font-size: 16.8px;
  font-weight: 300;
  top: -3px;
  left: -1.2em;
}

.linkListBox {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  background-color: rgb(255, 255, 255);
  margin: -1px -0.5px;
}

.linkListBox li {
  width: calc(33.3333% - 1px);
  margin: 0.5px;
}

.linkListBox li a {
  display: block;
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
  padding: 16px 40px 16px 16px;
  color: rgb(51, 51, 51);
  text-decoration: none;
  -webkit-transition: background-color 0.4s ease 0s;
  transition: background-color 0.4s ease 0s;
  background-color: rgb(239, 239, 239);
  position: relative;
}

.linkListBox li a::before {
  content: "";
  display: block;
  width: 0.6em;
  height: 0.6em;
  border-style: solid;
  border-color: rgb(51, 51, 51);
  -o-border-image: initial;
  border-image: initial;
  border-width: 1px 1px 0px 0px;
  position: absolute;
  top: 50%;
  right: 20px;
  -webkit-transform: translateY(-50%) rotate(45deg);
  transform: translateY(-50%) rotate(45deg);
}

.slick-slide img {
  margin: 0 auto;
}

.mv__item.slick-slide img {
  width: 100%;
  max-width: 100%;
}

.infoList__banneritem img {
  width: 100%;
  max-width: 100%;
}

body[data-device=tab] .megadrop__hook {
  pointer-events: none;
}

body[data-device=tab] .megadrop__hook.megadrop_linkonly {
  pointer-events: auto !important;
}

body[data-device=tab] .megadrop__hook:hover {
  text-decoration: none;
  color: white !important;
}

.content {
  width: 1200px;
  padding: 0 3rem;
  box-sizing: content-box;
  margin-inline: auto;
}

/*@media screen and (max-width: 767px) {
  .content {
    width: min(100% - 40px, 335px);
  }
}*/

.pageTitle {
  height: auto;
  position: relative;
  color: #2D2E31;
  margin-bottom: 24px;
  display: flex;
  flex-direction: row;
}

/*@media screen and (max-width: 767px) {
  .pageTitle {
    width: 100%;
    height: 160vw;
    flex-direction: column;
    margin-bottom: 8vw;
  }
}*/

.pageTitle__message {
  width: calc(100% - 1028px);
  min-width: 572px;
  position: relative;
  order: 0;
  padding-right: 50px;
  padding-left: 50px;
}

/*@media screen and (max-width: 767px) {
  .pageTitle__message {
    width: 100%;
    margin-inline: auto;
    min-width: 1px !important;
  }
}*/

.pageTitle__message span {
  position: absolute;
  display: block;
  font-size: 28px;
  line-height: 1.5;
  font-weight: 300;
  padding-top: 15px;
  padding-bottom: 15px;
	margin: auto;
	left: 0;
	right: 0;
	width:fit-content;
/*  margin-right: 50px;
  margin-left: 50px;*/
    top: 50%;
    transform: translateY(-40%);
    max-width: 80%;
   font-family: "Yu Mincho", "YuMincho", "Hiragino Mincho ProN", "Noto Serif", "Noto sans JP", sans-serif;
  background-image: linear-gradient(to right, #000 2px, transparent 6px), linear-gradient(to bottom, #000 0px, transparent 6px), linear-gradient(to left, #000 2px, transparent 6px), linear-gradient(to top, #000 0px, transparent 6px);
  background-size: 8px 2px, 0, 8px 2px, 0;
  background-repeat: repeat-x, repeat-y, repeat-x, repeat-y;
  background-position: left top, right top, right bottom, left bottom;
}

/*@media screen and (max-width: 767px) {
  .pageTitle__message span {
    position: relative;
    top: 0;
    padding-left: 0;
    font-size: 6.3466666667vw;
    width: min(100% - 40px, 335px);
    margin-left: 0;
    margin-right: 0;
    margin-inline: auto;
    margin-top: 8vw;
  }
}*/

.pageTitle__wrap {
  min-width: 1028px;
  top: 0;
  right: 0;
  position: relative;
  order: 1;
  overflow: hidden;
}

/*@media screen and (max-width: 767px) {
  .pageTitle__wrap {
    min-width: 1px;
    order: -1;
  }
}*/

.pageTitle__img {
  width: 100%;
  height: auto;
}

.pageTitle__wave {
  position: absolute;
  height: 100%;
  top: 0;
  right: 1px;
  transform: translateX(100%);
  z-index: 1;
}

/*@media screen and (max-width: 767px) {
  .pageTitle__wave {
    top: -63px;
    right: 0;
    width: 100%;
    height: 63px;
  }
}*/

.breadCrumb {
  line-height: 1.2;
  width: min(100% - 100px);
  margin-inline: auto;
  margin-bottom: 100px;
  font-size: 14px;
  font-weight: 300;
}

/*@media screen and (max-width: 767px) {
  .breadCrumb {
    width: min(100% - 40px, 335px);
    font-size: 2.6666666667vw;
    margin-bottom: 22.6666666667vw;
  }
}*/

.breadCrumb__list {
  letter-spacing: -0.5em;
  margin: 0;
}

.breadCrumb__item {
  list-style-type: none;
  line-height: 1.2;
  letter-spacing: 0.04em;
  display: inline-block;
  padding-right: 25px;
  position: relative;
  color: #7481d1;
}

.breadCrumb__item:last-of-type {
  color: #2d2e31;
}

.breadCrumb__item:not(:last-child):after {
  content: "";
  display: block;
  position: absolute;
  top: 50%;
  right: 10px;
  margin-top: -3.5px;
  width: 6px;
  height: 6px;
  border-top: solid 1px;
  border-right: solid 1px;
  border-color: #333;
  -webkit-transform: rotate(45deg);
  transform: rotate(45deg);
}

.breadCrumb__item a,
.breadCrumb__item strong {
  text-decoration: none;
}

.breadCrumb__item a:hover {
  text-decoration: underline;
}

.breadCrumb__item strong {
  font-weight: normal;
  display: inline-block;
}

.title00 {
  display: block;
  font-size: 18.2px;
  color: #a1aed1;
  padding-bottom: 15px;
  border-bottom: 1px solid #a1aed1;
  margin-bottom: 20px;
}

.title01 {
  margin-bottom: 120px;
  border-bottom: none;
   font-family: "Yu Mincho", "YuMincho", "Hiragino Mincho ProN", "Noto Serif", "Noto sans JP", sans-serif;
}

/*@media screen and (max-width: 767px) {
  .title01 {
    margin-bottom: 32vw;
  }
}*/

.title02 {
  margin-bottom: 80px;
   font-family: "Yu Mincho", "YuMincho", "Hiragino Mincho ProN", "Noto Serif", "Noto sans JP", sans-serif;
}

/*@media screen and (max-width: 767px) {
  .title02 {
    margin-bottom: 21.3333333333vw;
  }
}*/

.title03 {
  margin-bottom: 40px;
   font-family: "Yu Mincho", "YuMincho", "Hiragino Mincho ProN", "Noto Serif", "Noto sans JP", sans-serif;
}

/*@media screen and (max-width: 767px) {
  .title03 {
    margin-bottom: 21.3333333333vw;
  }
}*/

.title04 {
  margin-bottom: 40px;
   font-family: "Yu Mincho", "YuMincho", "Hiragino Mincho ProN", "Noto Serif", "Noto sans JP", sans-serif;
}

/*@media screen and (max-width: 767px) {
  .title04 {
    margin-bottom: 10.6666666667vw;
  }
}*/

.title05 {
  margin-bottom: 40px;
  font-family: "Yu Mincho", "YuMincho", "Hiragino Mincho ProN", "Noto Serif", "Noto sans JP", sans-serif;
}

/*@media screen and (max-width: 767px) {
  .title05 {
    margin-bottom: 10.6666666667vw;
  }
}*/

.title06 {
  margin-bottom: 120px !important;
  font-family: "Yu Mincho", "YuMincho", "Hiragino Mincho ProN", "Noto Serif", "Noto sans JP", sans-serif;
}

/*@media screen and (max-width: 767px) {
  .title06 {
    margin-bottom: 32vw !important;
  }
}*/

.title01, .title02 {
  font-size: 40.6px;
  line-height: 1.5;
  position: relative;
  font-weight: 300;
  color: #1e3c91;
  padding-bottom: 15px;
  border-bottom: 1px solid #A1AED1;
}

/*@media screen and (max-width: 767px) {
  .title01, .title02 {
    font-size: 6.3466666667vw;
  }
}*/

.title01:before, .title02:before {
  content: "";
  width: 1em;
  height: 1em;
  background-image: url(../img/module/headline-h2.png);
  background-repeat: no-repeat;
  background-size: contain;
  position: absolute;
  top: 0.3em;
  left: 0;
  z-index: -10;
}

.title03:not(.c-card__text) {
  font-size: 28px;
  line-height: 1.5;
  color: #1e3c91;
  padding: 17px 20px;
  border-radius: 5px;
  background-color: #e0e6f5;
  border: 1px solid #707070;
}

/*@media screen and (max-width: 767px) {
  .title03:not(.c-card__text) {
    font-size: 5.3333333333vw;
    padding: 4.5333333333vw 5.3333333333vw;
  }
}*/

.title04 {
  font-size: 28px;
  line-height: 1.425;
  position: relative;
  padding-left: 15px;
  border-bottom: 1px solid #A1AED1;
  margin-left: 5px;
  color: #1e3c91;
}

/*@media screen and (max-width: 767px) {
  .title04 {
    font-size: 5.3333333333vw;
    padding-left: 4vw;
  }
}*/

.title04:before {
  content: "";
  position: absolute;
  left: -5px;
  top: 50%;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
  width: 7px;
  height: 100%;
  background: -webkit-gradient(linear, left top, right top, from(#A1AED1), color-stop(70%, #A1AED1), color-stop(70%, #d9dfed), to(#d9dfed));
  background: linear-gradient(90deg, #A1AED1 0%, #A1AED1 70%, #d9dfed 70%, #d9dfed 100%);
  border-radius: 5px;
}

.title05 {
  font-size: 27px;
  line-height: 1.425;
  padding-left: 24px;
  position: relative;
  font-weight: 300;
  color: #1e3c91;
}

/*@media screen and (max-width: 767px) {
  .title05 {
    font-size: 5.3333333333vw;
    padding-left: 6.4vw;
  }
}*/

.title05:before,
.title05:after {
  content: "";
  position: absolute;
  left: 0;
  top: 50%;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
  border-radius: 50%;
}

.title05:before {
  border: 1px solid #A1AED1;
  width: 16px;
  height: 16px;
}

.title05:after {
  width: 10px;
  height: 10px;
  background-color: #A1AED1;
  left: 3px;
}

.title06 {
  font-size: 2.24rem;
  line-height: 1.425;
  position: relative;
  padding-left: 16px;
  font-weight: 300;
  color: #1e3c91;
}

/*@media screen and (max-width: 767px) {
  .title06 {
    font-size: 4.2666666667vw;
    padding-left: 4.2666666667vw;
  }
}*/

.title06:before {
  content: "";
  position: absolute;
  left: 0;
  top: 50%;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
  border-radius: 50%;
  width: 6px;
  height: 6px;
  background-color: #A1AED1;
}

.linkList>li>a {
  position: relative;
  padding-left: 1.5em;
  margin-bottom: 15px;
}

/*@media screen and (max-width: 767px) {
  .linkList>li>a {
    margin-bottom: 4vw;
  }
}*/

.linkList>li>a:before {
  content: "";
  display: block;
  width: 0;
  height: 0;
  border-style: solid;
  border-width: 0.3em 0 0.3em 0.35em;
  border-color: transparent transparent transparent #7481d1;
  position: absolute;
  top: 0.6em;
  left: 0.5em;
}

.linkList {
  color: #7481d1 !important;
  margin-bottom: 60px;
  font-weight: 300;
}

/*@media screen and (max-width: 767px) {
  .linkList {
    margin-bottom: 16vw;
  }
}*/

.linkList--col2,
.linkList--col3,
.linkList--col4 {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  list-style-type: none;
  margin: 60px -30px;
}

/*@media screen and (max-width: 767px) {

  .linkList--col2,
  .linkList--col3,
  .linkList--col4 {
    -webkit-box-orient: vertical;
    -webkit-box-direction: normal;
    -ms-flex-direction: column;
    flex-direction: column;
  }
}*/

.linkList--col2 li,
.linkList--col3 li,
.linkList--col4 li {
  width: calc(100% - 60px);
  margin: 1rem 30px !important;
}

/*@media screen and (max-width: 767px) {

  .linkList--col2 li,
  .linkList--col3 li,
  .linkList--col4 li {
    width: min(100% - 40px, 335px) !important;
    max-width: 100% !important;
    margin: 0 auto !important;
  }
}*/

.linkList--col2>li {
  width: calc(50% - 60px);
}

.linkList--col3>li {
  width: calc(33.3333333333% - 60px);
  max-width: calc(33% - 60px);
  margin: 30px !important;
  line-height: 1.7;
}

/*@media screen and (max-width: 767px) {
  .linkList--col3>li {
    margin: 0 auto !important;
  }
}*/

.linkList--col4>li {
  width: calc(25% - 60px);
}

.linkList--arrow {
  margin-bottom: 120px;
}

/*@media screen and (max-width: 767px) {
  .linkList--arrow {
    margin-bottom: 32vw;
  }
}*/

.linkList--arrow li {
  border-top: 1px solid #A1AED1;
  margin: 0 30px !important;
}

.linkList--arrow li:nth-of-type(n + 7) {
  border-bottom: 1px solid #A1AED1;
}

.linkList--arrow li a {
  position: relative;
  display: block;
  width: 100%;
  height: 100%;
  padding: 30px 50px 30px 10px;
  -webkit-transition: all 0.3s 0s ease;
  transition: all 0.3s 0s ease;
  font-size: 14px;
  line-height: 1.2142857143;
  font-weight: 300;
  color: #7481d1;
}

/*@media screen and (max-width: 767px) {
  .linkList--arrow li a {
    padding: 8vw 13.3333333333vw 8vw 2.6666666667vw;
    font-size: 3.7333333333vw;
  }
}*/

.linkList--arrow li a:before {
  display: none;
}

.linkList--arrow li a:after {
  content: "";
  display: block;
  width: 11px;
  height: 21px;
  background-image: url(../img/common/drawer-arrow-icon.svg);
  background-size: cover;
  background-repeat: no-repeat;
  position: absolute;
  top: 50%;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
  right: 0;
}

.linkList--arrow li a:hover {
  background-color: #e0e6f5;
}

.linkList--arrow li a:hover span {
  -webkit-transition: all 0.3s 0s ease;
  transition: all 0.3s 0s ease;
  display: block;
  -webkit-transform: translateX(10px);
  transform: translateX(10px);
}

.paragraph {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: horizontal;
  -webkit-box-direction: normal;
  -ms-flex-direction: row;
  flex-direction: row;
  margin-bottom: 66px;
}

/*@media screen and (max-width: 767px) {
  .paragraph {
    -webkit-box-orient: vertical;
    -webkit-box-direction: normal;
    -ms-flex-direction: column;
    flex-direction: column;
  }
}

@media screen and (max-width: 767px) {

  .image_right,
  .image_left {
    margin-left: 0;
    margin-right: 0;
    margin: 0 auto !important;
  }
}*/

.image_right {
  -webkit-box-ordinal-group: 2;
  -ms-flex-order: 1;
  order: 1;
  margin-left: 30px;
}

.caption {
  text-align: center;
  font-size: 1.4rem;
  color: #2d2e31 !important;
  font-weight: 300;
}

.float_text {
  width: calc(100% - 330px);
  max-width: 870px;
  -webkit-box-ordinal-group: 1;
  -ms-flex-order: 0;
  order: 0;
  font-size: 14px;
  font-weight: 300;
  line-height: 1.7;
  color: #2d2e31 !important;
}

/*@media screen and (max-width: 767px) {
  .float_text {
    width: 100%;
    max-width: 100%;
  }
}*/

.image_left {
  width: 300px;
  -webkit-box-ordinal-group: 0;
  -ms-flex-order: -1;
  order: -1;
  margin-right: 30px;
}

.linkBox {
  display: block;
  padding-left: 65px;
  background: url(../img/module/icon-linkbox.png) left center no-repeat;
  font-size: 1.68rem;
  font-weight: 500;
  text-decoration: none !important;
  color: #2d2e31 !important;
  -webkit-transition: all 0.3s;
  transition: all 0.3s;
  margin-bottom: 30px;
}

.linkBox__sub {
  display: block !important;
  font-size: 1.4rem;
  font-weight: 300;
}

.linkBox:hover {
  opacity: 0.75;
}

.linkBox.related {
  background: url(../img/module/icon-other.png) left center no-repeat;
}

.linkBox.related_link {
  background: url(../img/module/icon-other_window.png) left center no-repeat;
}

.linkBox.pdf {
  background: url(../img/module/icon-pdf.png) left center no-repeat;
}

.linkBox.news {
  background: url(../img/module/icon-news.png) left center no-repeat;
}

.linkBox.other {
  background: url(../img/module/icon-other.png) left center no-repeat;
}

.linkBox.other_window {
  background: url(../img/module/icon-other_window.png) left center no-repeat;
}

.linkBox.related {
  background: url(../img/module/icon-related.png) left center no-repeat;
}

.linkBox.word {
  background: url(../img/module/icon-word.png) left center no-repeat;
}

.linkBox.xls {
  background: url(../img/module/icon-xls.png) left center no-repeat;
}

.linkBox.news_other {
  background: url(../img/module/icon-news_other.png) left center no-repeat;
}

.linkBox.instagram {
  background: url(../img/module/instagram.png) left center no-repeat;
}

.linkBox.twitter {
  background: url(../img/module/twitter.png) left center no-repeat;
}

.linkBox.youtube {
  background: url(../img/module/youtube.png) left center no-repeat;
}

.linkBox.facebook {
  background: url(../img/module/facebook.png) left center no-repeat;
}

.linkBox.line {
  background: url(../img/module/line.png) left center no-repeat;
}

.linkBox.youtube-bk {
  background: url(../img/module/youtube-bk.png) left center no-repeat;
}

.linkBox.line-bk {
  background: url(../img/module/line-bk.png) left center no-repeat;
}

.linkBox.twitter-bk {
  background: url(../img/module/twitter-bk.png) left center no-repeat;
}

.linkBox.instagram-bk {
  background: url(../img/module/instagram-bk.png) left center no-repeat;
}

.linkBox.facebook-bk {
  background: url(../img/module/facebook-bk.png) left center no-repeat;
}

.link-list {
  display: flex;
  align-items: center;
}

.link-small {
  display: block;
  font-weight: 500;
  color: #2d2e31;
}

.link-small img {
  vertical-align: baseline;
  margin-left: 10px;
}

.link-small--other img {
  margin-left: 0;
  margin-right: 20px;
}

.link-small--sns {
  font-weight: 300 !important;
}

table[class^=table] {
  border-collapse: separate;
  /*border-spacing: 1px;*/
  border-spacing: 0.1em;
  background: #e5e5e5;
  margin-bottom: 60px;
}

table.w-100 {
  margin-bottom: 120px;
}

table[class^=table] th {
  background: #f0f3fa;
  padding: 25px;
  font-size: 14px;
  color: #2d2e31;
  font-weight: 500;
}

table[class^=table] td {
  background: white;
  padding: 25px;
}

table[class^=table] th>*:first-child,
table[class^=table] td>*:first-child {
  margin-top: 0;
}

table[class^=table] th>*:last-child,
table[class^=table] td>*:last-child {
  margin-bottom: 0;
}

.table th {
  background: #fafafa;
  text-align: center;
}

.table td {
  background: white;
}

.table02 thead th {
  background: #fafafa;
}

.table02 tbody th {
  font-weight: bold;
  background: white;
  text-align: left;
}

.table02 tbody td {
  background: white;
}

.table03 {
  border-collapse: collapse;
  border-spacing: 0;
  border: solid 1px #e5e5e5;
}

.table03 th,
.table03 td {
  border-bottom: solid 1px #e5e5e5;
}

.table03 th {
  background: #fafafa;
  text-align: left;
  vertical-align: middle;
}

.color-red {
  color: red;
}

.color-green {
  color: green;
}

.color-blue {
  color: blue;
}

.color-blue-dark {
  color: #000099;
}

.color-purple {
  color: #380096;
}

.color-red-01 {
  color: #c10435;
}

.image_right img,
.image_left img,
.image_top img,
.image_bottom img {
  max-width: 100%;
}

.image_right,
.image_left,
.image_top,
.image_bottom {
  margin: 1em auto;
  max-width: 100%;
  text-align: center;
}

.sns li {
  float: left;
  overflow: hidden;
  *zoom: 1;
  margin: 0 20px 0 0;
}

.sns li:nth-child(2) {
  width: 90px;
}

.sns li:nth-child(3) {
  width: 60px;
}

.sns li:nth-child(4) img {
  vertical-align: top;
}

.fb_iframe_widget span {
  vertical-align: top !important;
}

#movie_area p,
#movie_area ul,
#movie_area figure {
  margin: 0px 0px 2rem;
}

#movie_area .content__inner {
  position: relative;
  max-width: 120rem;
  background: #a1aed1;
  padding: 12rem 50%;
  margin-left: -50%;
  margin-right: -50%;
  -webkit-box-sizing: content-box;
  box-sizing: content-box;
  color: white;
}

/*@media only screen and (max-width: 767px) {
  #movie_area .content__inner {
    margin-top: 6rem;
    padding-left: 3rem;
    margin-left: -3rem;
    padding-right: 3rem;
    margin-right: -3rem;
  }
}*/

#movie_area .btnWrap {
  margin: 6rem auto;
}

#movie_area .btnWrap--center {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
  -ms-flex-pack: center;
  justify-content: center;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
}

.titleMovies {
  font-size: 28px;
  line-height: 1.5;
  margin: 0px 0px 3rem;
  letter-spacing: normal;
   font-family: "Yu Mincho", "YuMincho", "Hiragino Mincho ProN", "Noto Serif", "Noto sans JP", sans-serif;
  border-radius: 5px;
  background-color: #e0e6f5;
  color: #2d2e31;
  padding: 20px;
}

.leadMovies {
  font-size: 1.4rem;
  line-height: 1.8125;
  margin: 0px 0px 3rem !important;
  font-weight: 300;
}

/*@media only screen and (max-width: 767px) {
  .leadMovies {
    font-size: 1.4rem;
  }
}*/

/*@media only screen and (min-width: 768px) {*/
  .iframeWrap02 {
    margin: 0px;
    position: relative;
    height: 675px;
    width: 100%;
    max-height: 80vmin;
  }

  .iframeWrap02>* {
    margin: 0px;
  }

  .iframeWrap02>iframe {
    width: 100%;
    max-width: 142vmin;
    position: absolute;
    top: 0px;
    left: 50%;
    -webkit-transform: translateX(-50%);
    transform: translateX(-50%);
    height: 100% !important;
  }
/*}*/

/*@media only screen and (max-width: 767px) {
  .iframeWrap02 {
    margin: 0px;
    position: relative;
    width: 100%;
    padding-top: 56.25%;
    height: auto !important;
  }

  .iframeWrap02>* {
    margin: 0px;
  }

  .iframeWrap02>iframe {
    width: 100%;
    position: absolute;
    bottom: 0px;
    left: 0px;
    height: 100% !important;
  }
}*/

.iframeWrap {
  margin: 0px;
  position: relative;
  width: 100%;
  padding-top: 56.25%;
}

.iframeWrap>* {
  margin: 0px;
}

.iframeWrap>iframe {
  width: 100%;
  position: absolute;
  bottom: 0px;
  left: 0px;
  height: 100% !important;
}

.boxMovies {
  margin-bottom: 3rem;
}

.boxMovies:not(.is-current) {
  display: none;
}

.boxMovies.is-current {
  display: block;
}

.boxMovies__text {
  background: #696b72;
  padding: 2rem;
}

/*@media only screen and (max-width: 767px) {
  .boxMovies__text {
    padding: 1.5rem;
  }

  .boxMovies__text.is-open .boxMovies__detail {
    max-height: 100vw;
  }

  .boxMovies__text.is-open .boxMovies__detail::after {
    display: none;
  }

  .boxMovies__text.is-open .boxMovies__detail>div {
    max-height: 100vw;
    -webkit-transition: all 0.3s ease 0s;
    transition: all 0.3s ease 0s;
  }

  .boxMovies__text.is-open .boxMovies__detail .btnReadMore::after {
    -webkit-transform: translateX(-50%) rotate(135deg);
    transform: translateX(-50%) rotate(135deg);
  }
}*/

.boxMovies__title {
  margin: 0px 0px 1.5rem;
  font-size: 27px;
  font-weight: normal;
  font-weight: 300;
  line-height: 1.2444444444;
}

.boxMovies__title>span {
  display: inline-block;
  padding-bottom: 1rem;
  color: #fff;
  font-weight: 300;
}

/*@media only screen and (max-width: 767px) {
  .boxMovies__title {
    font-size: 1.4rem;
    line-height: 1.5;
  }
}*/

.boxMovies__detail p {
  font-size: 14px;
  font-weight: 300;
  line-height: 1.7;
}

.boxMovies__detail>* {
  margin: 0px 0px 1rem;
}

.boxMovies__detail> :last-child {
  margin-bottom: 0px;
}

/*@media only screen and (max-width: 767px) {
  .boxMovies__detail {
    font-size: 1.2rem;
  }

  .boxMovies__detail:not(.is-open) {
    max-height: 2rem;
    position: relative;
    -webkit-transition: all 0.3s ease 0s;
    transition: all 0.3s ease 0s;
  }

  .boxMovies__detail:not(.is-open)>div {
    max-height: 2rem;
    overflow: hidden;
    -webkit-transition: all 0.3s ease 0s;
    transition: all 0.3s ease 0s;
  }

  .boxMovies__detail:not(.is-open)::after {
    content: "";
    display: block;
    height: 8rem;
    width: calc(100% + 3rem);
    position: absolute;
    bottom: -1.5rem;
    left: -1.5rem;
    background: -webkit-gradient(linear, left top, left bottom, from(rgba(0, 0, 0, 0)), to(rgb(30, 60, 145)));
    background: linear-gradient(rgba(0, 0, 0, 0) 0%, rgb(30, 60, 145) 100%);
    z-index: 1;
  }

  .boxMovies__detail:not(.is-open) .btnMoreWrap {
    position: absolute;
    bottom: 0px;
    left: 50%;
    -webkit-transform: translateX(-50%);
    transform: translateX(-50%);
    z-index: 2;
  }
}*/

.btnMoreWrap {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
  -ms-flex-pack: center;
  justify-content: center;
}

.btnReadMore {
  font-size: 1rem;
  font-weight: bold;
  position: relative;
  color: white;
  padding-bottom: 1rem;
  text-decoration: none !important;
}

.btnReadMore::after {
  content: "";
  width: 0.5rem;
  height: 0.5rem;
  border-left: 0.2rem solid white;
  border-bottom: 0.2rem solid white;
  position: absolute;
  bottom: 0px;
  left: 50%;
  -webkit-transform: translateX(-50%) rotate(-45deg);
  transform: translateX(-50%) rotate(-45deg);
}

.thumbMovies {
  color: white;
  display: block;
  vertical-align: bottom;
  -webkit-transition: all 0.3s ease 0s;
  transition: all 0.3s ease 0s;
  text-decoration: none !important;
}

/*@media only screen and (max-width: 767px) {
  .thumbMovies {
    display: -webkit-box;
    display: -ms-flexbox;
    display: flex;
    -webkit-box-pack: start;
    -ms-flex-pack: start;
    justify-content: flex-start;
    margin-bottom: 0.5rem;
  }
}*/

.thumbMovies iframe {
  vertical-align: bottom;
}

.thumbMovies__image {
  pointer-events: none;
}

/*@media only screen and (max-width: 767px) {
  .thumbMovies__image {
    width: 7.7rem;
    height: 4.4rem;
  }
}*/

.thumbMovies__text {
  background: #696b72;
  font-size: 1.12rem;
  line-height: 1.6964285714;
  padding: 20px 20px 25px 20px;
  font-weight: 300;
}

/*@media screen and (max-width: 767px) {
  .thumbMovies__text {
    padding: 2.6666666667vw 5.3333333333vw;
  }
}*/

/*@media only screen and (max-width: 767px) {
  .thumbMovies__text {
    width: calc(100% - 7.7rem);
    font-size: 1rem;
    line-height: 1.6;
    max-height: 4.4rem;
    -webkit-box-sizing: border-box;
    box-sizing: border-box;
    overflow: hidden;
    position: relative;
  }
}*/

.thumbMovies__text> :last-child {
  margin-bottom: 0px !important;
}

.thumbMovies:hover {
  opacity: 0.75;
}

.thumbMovies.is-current {
  position: relative;
}

.thumbMovies.is-current::before {
  content: "";
  display: block;
  width: 100%;
  height: 100%;
  position: absolute;
  top: 0px;
  left: 0px;
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
  border: 0.4rem solid rgb(255, 240, 0);
  z-index: 1;
}

/*@media only screen and (max-width: 767px) {
  .thumbMovies.is-current::before {
    border-width: 0.2rem;
  }
}*/

/*@media only screen and (min-width: 768px) {*/
  .listMovies {
    display: -webkit-box;
    display: -ms-flexbox;
    display: flex;
    -webkit-box-pack: start;
    -ms-flex-pack: start;
    justify-content: flex-start;
    -ms-flex-wrap: wrap;
    flex-wrap: wrap;
    margin: 0px -0.5rem 4rem;
  }

  .listMovies>* {
    width: calc(20% - 1rem);
    margin: 1rem 0.5rem;
  }

  .listMovies> :first-child,
  .listMovies> :nth-child(2),
  .listMovies> :nth-child(3),
  .listMovies> :nth-child(4),
  .listMovies> :nth-child(5) {
    margin-top: 0px;
  }
/*}*/

/*@media only screen and (max-width: 767px) {
  .listMovies> :last-child {
    margin-bottom: 0px;
  }
}*/

.btnMovies {
  min-width: 26rem;
  min-height: 6rem;
  -webkit-box-sizing: border-box;
  box-sizing: border-box;
  border: 1px solid #fff;
  border-radius: 5px;
  padding: 0.2rem 0.5rem;
  display: table;
  text-align: center;
  color: white;
  font-weight: 500;
  -webkit-transition: all 0.3s ease 0s;
  transition: all 0.3s ease 0s;
  position: relative;
  margin: 0px 0px 1.5rem;
  text-decoration: none !important;
}

.btnMovies:hover {
  background-color: #fff;
  color: #7481d1;
}

.btnMovies:hover:after {
  background-color: #7481d1;
}

.btnMovies img {
  zoom: 1;
}

.btnMovies::after {
  content: "";
  -webkit-clip-path: polygon(0 0, 86.6% 50%, 0 100%);
  clip-path: polygon(0 0, 86.6% 50%, 0 100%);
  display: block;
  width: 0.7rem;
  height: 0.7rem;
  position: absolute;
  top: 50%;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
  right: 1rem;
  aspect-ratio: 1;
  background-color: #fff;
}

.btnMovies>span {
  display: table-cell;
  vertical-align: middle;
}

.btnMovies__icon {
  margin-left: 0.1rem;
  vertical-align: top;
  margin-top: 0.4rem;
}

@media only screen and (max-width: 1400px) {
  .iframeWrap02 {
    height: 410px;
    background: #696b72;
  }

  .iframeWrap02>iframe {
    max-width: 110vmin;
  }

  #movie_area .boxMovies__title {
    margin-bottom: 0px;
  }
}

.iframeWrap02 {
  background: #696b72;
}

.bgBlock01 {
  position: relative;
  overflow: hidden;
  padding: 11rem 10rem;
  height: 690px;
}

/*@media screen and (max-width: 767px) {
  .bgBlock01 {
    padding: 20px;
    height: auto;
  }
}*/

.bgBlock01__content {
  position: absolute;
  top: 50%;
  left: 50%;
  -webkit-transform: translate(-50%, -50%);
  transform: translate(-50%, -50%);
  z-index: 1;
  padding: 5rem;
  background: rgba(161, 174, 209, 0.92);
  color: #fff;
  width: 100%;
  max-width: 800px;
}

/*@media screen and (max-width: 767px) {
  .bgBlock01__content {
    position: relative;
    padding: 1.5rem;
    top: 0;
    left: 0;
    -webkit-transform: translate(0, 0);
    transform: translate(0, 0);
    max-width: 100%;
    margin-inline: auto;
  }
}*/

.bgBlock01__title {
  font-size: 28px;
  text-align: center;
  padding-bottom: 3rem;
  border-bottom: 1px solid #a1aed1;
  margin-bottom: 2.5rem;
  line-height: 1.5;
   font-family: "Yu Mincho", "YuMincho", "Hiragino Mincho ProN", "Noto Serif", "Noto sans JP", sans-serif;
  font-weight: 400;
}

/*@media screen and (max-width: 767px) {
  .bgBlock01__title {
    font-size: 5.3333333333vw;
  }
}*/

.bgBlock01__image {
  position: absolute;
  z-index: 0;
  top: 50%;
  left: 50%;
  -webkit-transform: translate(-50%, -50%);
  transform: translate(-50%, -50%);
  width: auto;
  height: auto;
  min-height: 100%;
  min-width: 100%;
  border-radius: 5px;
}

/*@supports ((-o-object-fit: cover) or (object-fit: cover)) {
  .bgBlock01__image {
    -o-object-fit: cover;
    object-fit: cover;
  }
}*/

.introductionBox01 {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: start;
  -ms-flex-pack: start;
  justify-content: flex-start;
  font-weight: 400;
}

/*@media screen and (max-width: 767px) {
  .introductionBox01 {
    -webkit-box-orient: vertical !important;
    -webkit-box-direction: normal !important;
    -ms-flex-direction: column !important;
    flex-direction: column !important;
  }
}*/

.introductionBox01--01 {
  -webkit-box-orient: horizontal;
  -webkit-box-direction: normal;
  -ms-flex-direction: row;
  flex-direction: row;
}

.introductionBox01--02 {
  -webkit-box-orient: horizontal;
  -webkit-box-direction: reverse;
  -ms-flex-direction: row-reverse;
  flex-direction: row-reverse;
}

.introductionBox01__content {
  padding: 0 0 3rem 3rem;
  -webkit-box-flex: 1;
  -ms-flex: 1 1 0%;
  flex: 1 1 0%;
}

/*@media screen and (max-width: 767px) {
  .introductionBox01__content {
    padding: 0;
  }
}*/

.introductionBox01__content p {
  width: 100%;
  max-width: 585px;
  font-weight: 300;
  line-height: 1.7;
  color: #2d2e31;
  font-size: 1.4rem;
}

.introductionBox01__content::after {
  content: "";
  display: block;
  clear: both;
}

.introductionBox01__title {
  font-size: 2.8rem;
  margin-bottom: 2rem;
  position: relative;
  padding-left: 15px;
  border-bottom: 1px solid #A1AED1;
  margin-left: 5px;
   font-family: "Yu Mincho", "YuMincho", "Hiragino Mincho ProN", "Noto Serif", "Noto sans JP", sans-serif;
  color: #1e3c91;
}

/*@media screen and (max-width: 767px) {
  .introductionBox01__title {
    font-size: 5.3333333333vw;
  }
}*/

.introductionBox01__title:before {
  content: "";
  position: absolute;
  left: -5px;
  top: 50%;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
  width: 7px;
  height: 100%;
  background: -webkit-gradient(linear, left top, right top, from(#A1AED1), color-stop(70%, #A1AED1), color-stop(70%, #d9dfed), to(#d9dfed));
  background: linear-gradient(90deg, #A1AED1 0%, #A1AED1 70%, #d9dfed 70%, #d9dfed 100%);
  border-radius: 5px;
}

.introductionBox01__btn {
  margin-top: 3rem;
  float: left;
  background: #fff;
  padding: 2.5rem;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
  -ms-flex-align: center;
  align-items: center;
  min-height: 6rem;
  min-width: 26rem;
  color: #7481d1;
  font-size: 1.2rem;
  -webkit-transition: all 0.3s ease 0s;
  transition: all 0.3s ease 0s;
  text-decoration: none !important;
  border: 1px solid #7481d1;
  border-radius: 5px;
  font-size: 14px;
  font-weight: 500;
  text-align: center;
  -webkit-box-pack: center;
  -ms-flex-pack: center;
  justify-content: center;
}

/*@media screen and (max-width: 767px) {
  .introductionBox01__btn {
    margin-bottom: 5.3333333333vw;
  }
}*/

.introductionBox01__btn:hover {
  color: #fff;
  background-color: #7481d1;
}

.introductionBox01__btn:hover span:before {
  background-color: #fff;
}

.introductionBox01__btn>span {
  position: relative;
  padding-right: 1.5rem;
  text-align: center;
}

.introductionBox01__btn>span::before {
  content: "";
  display: block;
  width: 0.7em;
  height: 0.7em;
  -webkit-clip-path: polygon(0 0, 86.6% 50%, 0 100%);
  clip-path: polygon(0 0, 86.6% 50%, 0 100%);
  position: absolute;
  top: 50%;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
  right: -58px;
  background-color: #7481d1;
}

.introductionList01__item {
  margin-bottom: 80px;
}

.introductionList01__item:first-of-type .introductionBox01__figure,
.introductionList01__item:last-of-type .introductionBox01__figure {
  margin-right: -120px;
}

/*@media screen and (max-width: 767px) {

  .introductionList01__item:first-of-type .introductionBox01__figure,
  .introductionList01__item:last-of-type .introductionBox01__figure {
    margin-right: 0;
  }
}*/

.introductionList01__item:first-of-type .introductionBox01__content,
.introductionList01__item:last-of-type .introductionBox01__content {
  padding: 0 3rem 3rem 0;
}

/*@media screen and (max-width: 767px) {

  .introductionList01__item:first-of-type .introductionBox01__content,
  .introductionList01__item:last-of-type .introductionBox01__content {
    padding: 0;
  }
}*/

.introductionList01__item:nth-of-type(2n) .introductionBox01__content {
  margin-right: -120px;
}

/*@media screen and (max-width: 767px) {
  .introductionList01__item:nth-of-type(2n) .introductionBox01__content {
    margin-right: 0;
  }
}*/

div.w-25,
div.w-50,
div.w-75 {
  margin-bottom: 16px;
  font-weight: 300;
}

h3.mb-40 {
   font-family: "Yu Mincho", "YuMincho", "Hiragino Mincho ProN", "Noto Serif", "Noto sans JP", sans-serif;
}

div.w-75 {
  margin-bottom: 126px;
}

div.mb-50,
div.ml-50,
div.mt-20 {
  font-weight: 300;
}

div.mb-50 img,
div.ml-50 img,
div.mt-20 img {
  margin-right: 10px;
}

div.mt-20 {
  margin-bottom: 120px;
}

.fw-300 {
  font-weight: 300;
}

.fz-10 {
  font-size: 1rem;
}

.m-infoList {
  margin-bottom: 120px;
}

.m-infoList__item {
  height: 85px;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: horizontal;
  -webkit-box-direction: normal;
  -ms-flex-direction: row;
  flex-direction: row;
  -webkit-box-align: center;
  -ms-flex-align: center;
  align-items: center;
  -webkit-box-pack: justify;
  -ms-flex-pack: justify;
  justify-content: space-between;
  border-bottom: 1px solid #e0e6f5;
  -webkit-transition: all 0.3s 0s ease;
  transition: all 0.3s 0s ease;
}

/*@media screen and (max-width: 767px) {
  .m-infoList__item {
    height: auto;
  }
}*/

.m-infoList__item:hover {
  background-color: #e0e6f5;
}

.m-infoList__item:hover .m-infoList__meta {
  -webkit-transition: all 0.3s 0s ease;
  transition: all 0.3s 0s ease;
  -webkit-transform: translateX(10px);
  transform: translateX(10px);
}

.m-infoList .m-title {
  margin-bottom: 10px;
  font-weight: 600;
  font-size: 1.2rem;
  font-family: "Barlow", "Tangerine", sans-serif;
  font-style: italic;
}

.m-infoList__meta {
  padding-left: 10px;
}

/*@media screen and (max-width: 767px) {
  .m-infoList__meta {
    padding: 5.3333333333vw 2.6666666667vw;
  }
}*/

/* 202302 追加 */
.buttonList {
  display: grid;
  gap: 30px;
}

/*@media screen and (max-width: 767px) {
  .buttonList {
    grid-template-columns: 1fr !important;
  }
}*/

.buttonList--col3 {
  grid-template-columns: 1fr 1fr 1fr;
}

.buttonList--col4 {
  grid-template-columns: 1fr 1fr 1fr 1fr;
}

.buttonList__button {
  background: #fff;
  padding: 10px 25px;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: justify;
  -ms-flex-pack: justify;
  justify-content: space-between;
  -webkit-box-align: center;
  -ms-flex-align: center;
  align-items: center;
  min-height: 6rem;
  color: #7481d1;
  -webkit-transition: all 0.3s ease 0s;
  transition: all 0.3s ease 0s;
  text-decoration: none !important;
  border: 1px solid #7481d1;
  border-radius: 5px;
  font-size: 14px;
  font-weight: 500;
  text-align: center;
}

.buttonList__button:hover {
  color: #fff;
  background-color: #7481d1;
}

.buttonList__button:hover::after {
  background-color: #fff;
}

.buttonList__button::after {
  content: "";
  display: block;
  width: 0.7em;
  height: 0.7em;
  -webkit-clip-path: polygon(0 0, 86.6% 50%, 0 100%);
  clip-path: polygon(0 0, 86.6% 50%, 0 100%);
  background-color: #7481d1;
}

.title04 {
  font-size: 28px;
  line-height: 1.425;
  position: relative;
  padding-left: 15px;
  border-bottom: 1px solid #A1AED1;
  margin-left: 5px;
  color: #1e3c91;
}

/*@media screen and (max-width: 767px) {
  .title04 {
    font-size: 5.3333333333vw;
    padding-left: 4vw;
  }
}*/

.title04:before {
  content: "";
  position: absolute;
  left: -5px;
  top: 50%;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
  width: 7px;
  height: 100%;
  background: -webkit-gradient(linear, left top, right top, from(#A1AED1), color-stop(70%, #A1AED1), color-stop(70%, #d9dfed), to(#d9dfed));
  background: linear-gradient(90deg, #A1AED1 0%, #A1AED1 70%, #d9dfed 70%, #d9dfed 100%);
  border-radius: 5px;
}

.backgroundBox {
  padding: 30px;
  background: #f0f3fa;
  border-radius: 5px;
}

/*@media screen and (max-width: 767px) {
  .backgroundBox {
    padding: 20px;
  }
}*/

.mediaBlock {
  margin: 0 0 4rem;
}

.mediaBlock__container {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  gap: 30px;
}

/*@media screen and (max-width: 767px) {
  .mediaBlock__container {
    display: block;
  }
}*/

.mediaBlock__img {
  -webkit-box-flex: 1;
  -ms-flex: 1;
  flex: 1;
}

/*@media screen and (max-width: 767px) {
  .mediaBlock__img {
    width: auto;
  }
}*/

.mediaBlock__img--small {
  -webkit-box-flex: unset;
  -ms-flex: unset;
  flex: unset;
  max-width: 300px;
}

/*@media screen and (max-width: 767px) {
  .mediaBlock__img--small {
    max-width: unset;
  }
}*/

.mediaBlock__body {
  -webkit-box-flex: 1;
  -ms-flex: 1;
  flex: 1;
}

/*@media screen and (max-width: 767px) {
  .mediaBlock__body {
    margin-top: 15px;
    width: auto;
  }
}*/

.mediaBlock__bodyHead {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  -webkit-box-align: center;
  -ms-flex-align: center;
  align-items: center;
  -webkit-box-pack: justify;
  -ms-flex-pack: justify;
  justify-content: space-between;
  gap: 10px 20px;
  padding-bottom: 7px;
  border-bottom: 1px solid #a1aed1;
}

.mediaBlock__bodyTitle {
  font-size: 2.8rem;
   font-family: "Yu Mincho", "YuMincho", "Hiragino Mincho ProN", "Noto Serif", "Noto sans JP", sans-serif;
  color: #1e3c91;
}

.mediaBlock__bodyTitle small {
  display: block;
  font-weight: 300;
  font-size: 1.4rem;
   font-family: "Noto sans JP", "Yu Mincho", "YuMincho", "Hiragino Mincho ProN", "Noto Serif", sans-serif;
}

.mediaBlock__bodyTitle small span {
  padding-left: 15px;
  font-weight: 700;
  font-size: 1rem;
}

.mediaBlock__bodyList {
  display: grid;
  grid-template-columns: repeat(auto-fit, minmax(180px, 1fr));
  gap: 10px 15px;
}

/*@media screen and (max-width: 767px) {
  .mediaBlock__bodyList {
    grid-template-columns: repeat(auto-fit, minmax(250px, 1fr));
  }
}*/

.mediaBlock__button {
  position: relative;
  background: #fff;
  padding: 10px 15px;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: justify;
  -ms-flex-pack: justify;
  justify-content: space-between;
  -webkit-box-align: center;
  -ms-flex-align: center;
  align-items: center;
  gap: 15px;
  min-height: 35px;
  color: #7481d1;
  -webkit-transition: all 0.3s ease 0s;
  transition: all 0.3s ease 0s;
  text-decoration: none !important;
  border: 1px solid #7481d1;
  border-radius: 5px;
  font-size: 10px;
  font-weight: 500;
  text-align: center;
  cursor: pointer;
}

.mediaBlock__button::after {
  content: "";
  display: block;
  width: 6px;
  height: 8px;
  -webkit-clip-path: polygon(0 0, 86.6% 50%, 0 100%);
  clip-path: polygon(0 0, 86.6% 50%, 0 100%);
  background-color: #7481d1;
}

.mediaBlock__button:hover {
  color: #fff;
  background-color: #7481d1;
}

.mediaBlock__button:hover::after {
  background-color: #fff;
}

.mediaBlock__button.mediaBlock__bodyHeadButton {
  -webkit-box-pack: center;
  -ms-flex-pack: center;
  justify-content: center;
  width: 130px;
}

.mediaBlock__button.mediaBlock__bodyHeadButton::after {
  content: "";
  position: absolute;
  top: 50%;
  right: 10px;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
}

.mediaBlock__button.mediaBlock__button--inline {
  display: -webkit-inline-box;
  display: -ms-inline-flexbox;
  display: inline-flex;
}

.linkArea__title {
  text-align: center;
  font-size: 1.6rem;
   font-family: "Yu Mincho", "YuMincho", "Hiragino Mincho ProN", "Noto Serif", "Noto sans JP", sans-serif;
  color: #1e3c91;
  font-weight: 500;
}

.linkArea__list {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
  flex-wrap: wrap;
  gap: 10px 15px;
  margin: 30px 0 0;
}

/*@media screen and (max-width: 767px) {
  .linkArea__listItem {
    width: 100%;
  }
}*/

.linkArea__button {
  position: relative;
  display: -webkit-inline-box;
  display: -ms-inline-flexbox;
  display: inline-flex;
  -webkit-box-align: center;
  -ms-flex-align: center;
  align-items: center;
  -webkit-box-pack: center;
  -ms-flex-pack: center;
  justify-content: center;
  padding: 10px 25px 10px 10px;
  min-width: 123px;
  font-size: 1rem;
  min-height: 35px;
  color: #7481D1;
  text-decoration: none !important;
  background: #fff;
  border: 1px solid #7481D1;
  border-radius: 5px;
  -webkit-transition: all 0.3s ease 0s;
  transition: all 0.3s ease 0s;
}

/*@media screen and (max-width: 767px) {
  .linkArea__button {
    display: -webkit-box;
    display: -ms-flexbox;
    display: flex;
  }
}*/

.linkArea__button::after {
  content: "";
  position: absolute;
  top: 50%;
  right: 10px;
  width: 8px;
  height: 6px;
  background: #7481D1;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
  -webkit-clip-path: polygon(0 0, 100% 0%, 50% 86.6%);
  clip-path: polygon(0 0, 100% 0%, 50% 86.6%);
}

.linkArea__button:hover {
  color: #fff;
  background: #7481D1;
}

.linkArea__button:hover::after {
  background: #fff;
}

.linkArea__button--noArrow {
  padding: 10px;
}

.linkArea__button--noArrow::after {
  display: none;
}

.backgroundBox__title {
   font-family: "Yu Mincho", "YuMincho", "Hiragino Mincho ProN", "Noto Serif", "Noto sans JP", sans-serif;
  font-size: 2.8rem;
  padding-bottom: 5px;
  border-bottom: 1px solid #A1AED1;
  color: #1e3c91;
}

.summaryGroup {
  display: grid;
  grid-template-columns: 1fr 1fr;
  gap: 20px 60px;
}

/*@media screen and (max-width: 767px) {
  .summaryGroup {
    grid-template-columns: 1fr;
  }
}*/

.summaryGroup__item dt {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
  -ms-flex-align: center;
  align-items: center;
  -webkit-box-pack: center;
  -ms-flex-pack: center;
  justify-content: center;
  padding: 5px;
  min-height: 66px;
   font-family: "Yu Mincho", "YuMincho", "Hiragino Mincho ProN", "Noto Serif", "Noto sans JP", sans-serif;
  font-size: 2.8rem;
  font-weight: 400;
  background: #e0e6f5;
  border: 1px solid #A1AED1;
  border-radius: 5px;
  color: #1e3c91;
}

.summaryGroup__item dd {
  margin-top: 30px;
}

.summaryGroup__item dd ul {
  margin: 0;
}

.summaryGroup__item dd li {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  gap: 5px;
}

.summaryGroup__item dd li+li {
  margin-top: 10px;
}

.summaryGroup__item dd li::before {
  content: "";
  -ms-flex-negative: 0;
  flex-shrink: 0;
  margin-top: 10px;
  width: 5px;
  height: 5px;
  background: #E0E6F5;
  border-radius: 50%;
}

.flowBox{
  margin: 0 0 4rem;
}

.flowBox__group {
  position: relative;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  margin: 0;
  padding: 30px;
  background: #fff;
  border-radius: 3px;
}

/*@media screen and (max-width: 767px) {
  .flowBox__group {
    display: block;
  }
}*/

.flowBox__group:not(:last-child) {
  margin-bottom: 30px;
}

.flowBox__group:not(:last-child)::after {
  content: "";
  position: absolute;
  top: calc(100% + 10px);
  left: 50%;
  width: 16px;
  height: 12px;
  background: #7481D1;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
  -webkit-clip-path: polygon(0 0, 100% 0%, 50% 86.6%);
  clip-path: polygon(0 0, 100% 0%, 50% 86.6%);
  -webkit-transform: translateX(-50%);
  transform: translateX(-50%);
}

.flowBox__group dt {
  -ms-flex-negative: 0;
  flex-shrink: 0;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-align: center;
  -ms-flex-align: center;
  align-items: center;
  -webkit-box-pack: center;
  -ms-flex-pack: center;
  justify-content: center;
  line-height: 1;
   font-family: "Yu Mincho", "YuMincho", "Hiragino Mincho ProN", "Noto Serif", "Noto sans JP", sans-serif;
  font-weight: 400;
  font-size: 2.8rem;
}

.flowBox__group dd {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
}

/*@media screen and (max-width: 767px) {
  .flowBox__group dd {
    display: block;
  }
}*/

.flowBox__group dd::before {
  content: "";
  display: block;
  -ms-flex-negative: 0;
  flex-shrink: 0;
  margin: 0 15px;
  width: 1px;
  height: 100%;
  background: #A1AED1;
}

/*@media screen and (max-width: 767px) {
  .flowBox__group dd::before {
    margin: 15px 0;
    width: 100%;
    height: 1px;
  }
}*/

.thumbnailSlider__main {
  max-width: 800px;
  margin: auto;
  border-radius: 5px;
  overflow: hidden;
}

.thumbnailSlider__gallery {
  margin-top: 10px;
}

.thumbnailSlider__gallery .slick-track {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
  -ms-flex-pack: center;
  justify-content: center;
  width: calc(100% + 20px);
}

.thumbnailSlider__gallery .slick-slide {
  display: -webkit-box !important;
  display: -ms-flexbox !important;
  display: flex !important;
  max-width: 80px;
  margin: 0 5px;
  border: 2px solid rgba(251, 244, 157, 0);
  overflow: hidden;
  border-radius: 5px;
}

.thumbnailSlider__gallery .slick-slide.slick-current {
  border-color: #FBF49D;
}

.thumbnailSlider__gallery .slick-slide img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
}

.thumbnailSlider__galleryItem {
  cursor: pointer;
  height: 100%;
}

/*@media screen and (max-width: 767px) {
  .table-wrap {
    overflow-x: auto;
  }
}*/

.table-wrap .table {
  margin-bottom: 20px;
}

/*@media screen and (max-width: 767px) {
  .table-wrap .table {
    width: -webkit-max-content !important;
    width: -moz-max-content !important;
    width: max-content !important;
  }
}*/

.photoGallery01 {
  margin: 6rem 0;
}
.photoGallery01 img{
  vertical-align: bottom;
}
.photoGallery01__list {
  display: block;
  margin: 0 auto;
  border-radius: 0.3rem;
  overflow: hidden;
  position: relative;
}
.photoGallery01__item {
  margin: 0;
  display: none;
  position: absolute;
  top: 50%;
  left: 50%;
  width: 100%;
  height: auto;
  -webkit-transform: translate(-50%, -50%);
          transform: translate(-50%, -50%);
  -webkit-transition: opacity 1.2s;
  transition: opacity 1.2s;
}
.photoGallery01__item.is-active {
  display: block;
  opacity: 0;
}
.photoGallery01__item.is-active.is-show {
  opacity: 1;
}
.photoGallery01__item figcaption {
  position: absolute;
  bottom: 0;
  left: 0;
  width: 100%;
  width: 100%;
  max-height: 100%;
  margin: 0;
  padding: 2rem 1rem;
  color: #fff;
  font-size: 1.4rem;
  line-height: 1.4;
  text-align: center;
  background: rgba(0, 0, 0, 0.2);
  opacity: 0;
  -webkit-transition: all 0.4s;
  transition: all 0.4s;
}
.photoGallery01__item:hover figcaption {
  opacity: 1;
}
.photoGallery01 .js-photoGallery__thumbList {
  overflow-x: auto;
  margin: 1.5rem auto 0;
}
.photoGallery01 .js-photoGallery__thumbList::-webkit-scrollbar {
  width: 0.6rem;
  height: 0.6rem;
}
.photoGallery01 .js-photoGallery__thumbList::-webkit-scrollbar-track {
  background-color: #e0e6f5;
}
.photoGallery01 .js-photoGallery__thumbList::-webkit-scrollbar-thumb {
  background-color: #7481d1;
}
.photoGallery01 .js-photoGallery__thumbList__inner {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: center;
      -ms-flex-pack: center;
          justify-content: center;
  width: -webkit-max-content;
  width: -moz-max-content;
  width: max-content;
  margin: -1.5rem -0.7rem 1rem;
}
.photoGallery01 .js-photoGallery__thumbList__inner > a {
  display: inline-block;
  margin: 1.5rem 0.7rem 0;
  width: 11rem;
  height: auto;
  border-radius: 0.3rem;
  overflow: hidden;
  position: relative;
}
.photoGallery01 .js-photoGallery__thumbList__inner > a:before {
  content: "";
  display: block;
  width: 100%;
  height: 100%;
  border-radius: 0.3rem;
  position: absolute;
  left: 0;
  top: 0;
  border: solid 1px transparent;
  -webkit-transition: all 0.3s;
  transition: all 0.3s;
}
.photoGallery01 .js-photoGallery__thumbList__inner > a img {
  width: 100%;
  height: 100%;
  -o-object-position: center center;
     object-position: center center;
  -o-object-fit: cover;
     object-fit: cover;
}
.photoGallery01 .js-photoGallery__thumbList__inner > a.is-active:before {
  border: solid 1px #FBF49D;
}

.flow {
  margin: 0 auto 4rem;
  width: 1100px;
}
.flow > dl {
  padding: 1rem 0;
  border-top: 1px solid #1e3c91;
  border-bottom: 1px solid #1e3c91;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-pack: justify;
      -ms-flex-pack: justify;
          justify-content: space-between;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
}
.flow > dl:not(:last-child) {
  margin-bottom: 2rem;
}
.flow > dl dt {
  width: 12rem;
  padding: 2rem 0;
  background-color: #e0e6f5;
  color: #1e3c91;
   font-family: "Yu Mincho", "YuMincho", "Hiragino Mincho ProN", "Noto Serif", "Noto sans JP", sans-serif;
  font-size: 2.4rem;
  text-align: center;
  -webkit-box-sizing: border-box;
          box-sizing: border-box;
}
.flow > dl dd {
  width: 95rem;
  font-size: 1.54rem;
}

.panel02 {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -webkit-box-orient: horizontal;
  -webkit-box-direction: reverse;
      -ms-flex-direction: row-reverse;
          flex-direction: row-reverse;
  margin-bottom: 4rem;
}
.panel02__body {
  -webkit-box-flex: 1;
      -ms-flex: 1;
          flex: 1;
}
.panel02__body__head {
  margin-bottom: 2.5rem;
  position: relative;
  padding: 1rem 1.5rem;
  background-color: #e0e6f5;
/*  border-top: 1px solid #A1AED1;*/
  border-top: 1px solid #A1AED1;
}
.panel02__body__head .panel02__keywords {
  position: absolute;
  top: 50%;
  right: 1.5rem;
  -webkit-transform: translateY(-50%);
          transform: translateY(-50%);
}
.panel02__title {
  font-size: 2.2rem;
  line-height: 1.6363636364;
  font-weight: 400;
  margin-bottom: 0;
  color: #1e3c91;
   font-family: "Yu Mincho", "YuMincho", "Hiragino Mincho ProN", "Noto Serif", "Noto sans JP", sans-serif;
}
.panel02__figure {
  max-width: 35rem;
  margin-right: 4.2rem;
}
.panel02__figure img {
  overflow: hidden;
}
.panel02__keywords {
  font-size: 1.2rem;
  font-weight: normal;
  color: #1e3c91;
}
.panel02__btns {
  margin-top: 3.5rem;
}
.panel02__btn {
  font-size: 1.2rem;
  position: relative;
  overflow: hidden;
  display: block;
  width: 200px;
  padding: 4px 15px 4px 10px;
  background: #fff;
  color: #1e3c91;
  border: 1px solid #7481d1;
  box-sizing: border-box;
  text-decoration: none;
  z-index: 1;
  transition: .4s;
}
.panel02__btn:before{
  background:#FFF000;
  content: "";
  position: absolute;
  left: 0;
  top: 0;
  width: 100%;
  height: 100%;
  transform: translateX(-100%);
  transition: transform ease .4s;
  z-index: -1;
}
.panel02__btn:after {
  content: "";
  display: block;
  height: .6rem;
  width: .6rem;
  border-top: solid 1px #7481d1;
  border-right: solid 1px #7481d1;
  position: absolute;
  right: 0.8rem;
  top: 50%;
  -webkit-transform: translateY(-50%) rotate(45deg);
          transform: translateY(-50%) rotate(45deg);
  -webkit-transition: all 0.4s;
  transition: all 0.4s;
}
.panel02__btn:hover {
  opacity: 1;
  background: #FFF000;
  text-decoration: none;
}
.panel02__btn:hover:before {
  transform: translateX(10%);
}

.professorArea {
  width: 1200px;
  margin: 100px auto;
}

.ttl_circle {
  margin-bottom: 0;
  margin: 0;
  padding: 0;
  color: #1e3c91;
  border: 0;
  font-size: 1.54rem;
}
.ttl_circle:before {
  display: inline-block;
  content: "";
  width: 12px;
  height: 12px;
  margin-right: 10px;
  background: #1e3c91;
  border-radius: 50px;
  border: 2px solid #fff;
  box-shadow: 0 0 0 1px #1e3c91;
}
.professorArea .note {
  margin: 0;
}
.professor_list {
  margin: 0 auto 30px;
}
.professor_ttl {
  display: flex;
  justify-content: space-between;
  margin-top: 40px;
}
.professor_ttl dt,
.professor_ttl dd {
  padding: 10px 15px;
  border: 1px solid #1e3c91;
  border-color: #A1AED1;
  color: #1e3c91;
  box-sizing: border-box;
}
.professor_ttl dt,
.professor_list dt{
  width: 300px;
  box-sizing: border-box;
}
.professor_ttl dd.field,
.professor_list dd.field{
  width: 630px;
  box-sizing: border-box;
  color: #1e3c91;
  background-color: #e0e6f5;
   font-family: "Yu Mincho", "YuMincho", "Hiragino Mincho ProN", "Noto Serif", "Noto sans JP", sans-serif;
}
.professor_ttl dd.web {
  width: 252px;
}

.professor_list dl {
  display: flex;
  justify-content: space-between;
  margin: 0 0 10px;
}
.professor_list dt,
.professor_list dd.field {
  padding: 10px 15px;
  border-top: 1px solid #1e3c91;
  border-bottom: 1px solid #1e3c91;
  border-color: #A1AED1;
  font-size: 1.4rem;
}
.professor_list dt {
  position: relative;
  display: flex;
  align-items: center;
}
.professor_list dt:before {
  position: absolute;
  top: 50%;
  margin-top: -7px;
  left: 0;
  content: "";
  display: block;
  width: 5px;
  height: 14px;
  background: #1e3c91;
}
.professor_list dt span {
  margin-top: -10px;
    font-size: 0.98rem;
}
.professor_list dd.field {
  display: flex;
  align-items: center;
  color: #1e3c91;
  font-weight: bold;
}
.professor_list dd.web {
  width: 120px;
  border: 1px solid #1e3c91;
  border-color: #A1AED1;
  box-sizing: border-box;
}
.professor_list dd.web a {
  position: relative;
  overflow: hidden;
  display: flex;
  justify-content: center;
  align-items: center;
  width: 100%;
  height: 100%;
  padding: 12px;
  color: #1e3c91;
  font-size: 0.98rem;
  line-height: 1.2;
  text-align: center;
  box-sizing: border-box;
  z-index: 1;
  transition: .4s;
}
.professor_list dd.web a:hover {
  background: #FFF000;
  text-decoration: none;
}
.professor_list dd.web a:before {
  background:#FFF000;
  content: "";
  position: absolute;
  left: 0;
  top: 0;
  width: 100%;
  height: 100%;
  transform: translateX(-100%);
  transition: transform ease .4s;
  z-index: -1;
}
.professor_list dd.web a:hover:before{
  transform: translateX(10%);
}
.professor_list dd.web.professor_list_1column {
  width: 252px;
}
.professor_list--nolink dd.field{
  width: 890px;
}


//add 20230315
.guide_ .row {
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: wrap;
      flex-wrap: wrap;
  list-style-type: none;
  margin: -4.2rem -2.1rem 5rem;
}
.guide_ .row__col {
  width: calc(100% - 4.2rem);
  margin: 4.2rem 2.1rem 0;
}
.guide_ .row__col > *:last-child {
  margin-bottom: 0 !important;
}
.guide_ .row__col a[class*=btn0] {
  min-width: 0;
  width: 100%;
}
.guide_ .row--col2 > .row__col {
  width: calc(50% - 4.2rem);
}

.guide_ .row .row_flex img{
    height: 90px!important;
    width: 90px!important;
    max-width: unset;
}

.guide_ .row_flex{
  display:flex;
}

.guide_ .row_flex .row_text{
  margin-left: 2rem;
}
.guide_ dt {
    color: #1e3c91;
    font-size: 1.9rem;
}
.guide_ .row_text{
  display: flex;
  flex-direction: column;
  width: 100%;
}

.guide_ .row_text .introductionBox01__btns{
  margin-left: auto;
  margin-top:  auto;
}

.guide_ .row_text .introductionBox01__btns .btn02{
  min-height: 0;
  height:4rem;
    background-color: #fff;
}

.guide_ .btn02 {
  display: -webkit-inline-box;
  display: -ms-inline-flexbox;
  display: inline-flex;
  -webkit-box-align: center;
      -ms-flex-align: center;
          align-items: center;
  min-width: 28rem;
  min-height: 5.8rem;
  padding: 1rem 3.5rem 1rem 1.5rem;
  color: #1e3c91;
  font-weight: 500;
  border: 2px solid #1e3c91;
  position: relative;
  text-decoration: none;
  -webkit-transition: 0.4s;
  transition: 0.4s;
}
.guide_ .btn02:after {
  content: "";
  display: block;
  width: 2.5rem;
  height: 0.8rem;
  background-position: center center;
  background-repeat: no-repeat;
  background-size: cover;
  background-image: url("data:image/svg+xml;charset=utf8,%3Csvg%20xmlns%3D%22http%3A%2F%2Fwww.w3.org%2F2000%2Fsvg%22%20width%3D%2227.37%22%20height%3D%228.197%22%20viewBox%3D%220%200%2027.37%208.197%22%3E%0A%20%20%3Cpath%20id%3D%22icon_arrow01%22%20d%3D%22M511.5%2C16658.438h25l-6.333-6.5%22%20transform%3D%22translate(-511.5%20-16651.24)%22%20fill%3D%22none%22%20stroke%3D%22%231e3c91%22%20stroke-width%3D%222%22%2F%3E%0A%3C%2Fsvg%3E%0A");
  position: absolute;
  top: 43%;
  right: 1rem;
}
.content .guide_ dd {
    font-family: "Noto sans JP", "Yu Mincho", "YuMincho", "Hiragino Mincho ProN", "Noto Serif", sans-serif;
}